:Setiptiline

{{Short description|Antidepressant drug}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 464389691

| IUPAC_name = 2-methyl-2,3,4,9-tetrahydro-1H-dibenzo[3,4:6,7]cyclohepta[1,2-c]pyridine

| image = Setiptiline 2D structure.svg

| width = 200px

| tradename = Tecipul

| Drugs.com = {{drugs.com|international|setiptiline}}

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 57262-94-9

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| PubChem = 5205

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = DB09304

| ChEBI = 135076

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 5016

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7L38105Z6E

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D08511

| synonyms = Teciptiline; delta(13b,4a),4a-Carba-mianserin; MO-8282; ORG-8282

| C=19 | H=19 | N=1

| SMILES = c42c(\C3=C(/c1ccccc1C2)CN(C)CC3)cccc4

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H19N/c1-20-11-10-18-16-8-4-2-6-14(16)12-15-7-3-5-9-17(15)19(18)13-20/h2-9H,10-13H2,1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = GVPIXRLYKVFFMK-UHFFFAOYSA-N

}}

Setiptiline (brand name Tecipul), also known as teciptiline, is a tetracyclic antidepressant (TeCA) that acts as a noradrenergic and specific serotonergic antidepressant (NaSSA). It was launched in 1989 for the treatment of depression in Japan by Mochida.{{cite book | vauthors = Holenz J, Díaz JL, Buschmann H | chapter = Chemistry: Tricyclic and tetracyclic antidepressants | doi = 10.1002/9783527619337.ch5 | veditors = Buschmann H, Torrens A, Vela JM | chapter-url = https://books.google.com/books?id=yXD4QA-Y_Z0C&pg=PA248 | title = Antidepressants, Antipsychotics, Anxiolytics: From Chemistry and Pharmacology to Clinical Application | volume = 1 | page = 248 | publisher = Wiley VCH | year = 2007 | isbn = 978-3-527-31058-6 }}{{Dead link|date=March 2024 |bot=InternetArchiveBot |fix-attempted=yes }}{{ cite book | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA942 | title = Index Nominum 2000: International Drug Directory | page = 942 | editor = Swiss Pharmaceutical Society | publisher = Medpharm Scientific Publishers | year = 2000 | isbn = 3-88763-075-0 }}