:Testosterone glucuronide

{{Chembox

| ImageFile = Testosterone glucuronide.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = 3-Oxoandrost-4-en-17β-yl β-D-glucopyranosiduronic acid

| SystematicName = (2S,3S,4S,5R,6R)-3,4,5-Trihydroxy-6-{[(1S,3aS,3bR,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,5,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl]oxy}oxane-2-carboxylic acid

| OtherNames = Androst-4-en-17β-ol-3-one 17β-D-glucuronide

| Section1 = {{Chembox Identifiers

| CASNo = 1180-25-2

| ChemSpiderID = 97270

| ChEBI = 28835

| ChEMBL =

| KEGG = C11134

| PubChem = 108192

| StdInChI = 1S/C25H36O8/c1-24-9-7-13(26)11-12(24)3-4-14-15-5-6-17(25(15,2)10-8-16(14)24)32-23-20(29)18(27)19(28)21(33-23)22(30)31/h11,14-21,23,27-29H,3-10H2,1-2H3,(H,30,31)/t14-,15-,16-,17-,18-,19-,20+,21-,23+,24-,25-/m0/s1

| StdInChIKey = NIKZPECGCSUSBV-HMAFJQTKSA-N

| SMILES = [H][C@@]12CC[C@H](O[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)C(O)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C

| UNII =

}}

| Section2 = {{Chembox Properties

| C=25 | H=36 | O=8

| MolarMass = 464.555 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Testosterone glucuronide is an endogenous, naturally occurring steroid and minor urinary metabolite of testosterone.{{cite HMDB|author1-link=David S. Wishart|url=http://www.hmdb.ca/metabolites/hmdb03193|title=Showing metabocard for Testosterone glucuronide (HMDB03193)}}

See also

References

{{Reflist}}

{{Steroid hormones}}

Category:Testosterone

Category:Glucuronide esters

Category:Human metabolites

{{steroid-stub}}

{{biochemistry-stub}}