:Tetramethylammonium pentafluoroxenate

{{chembox

| verifiedrevid = 366065760

| ImageFile1 = Tetramethylammonium-pentafluoroxenate-xtal-3D-vdW.png

| ImageSize1 =

| ImageFileL2 = Tetramethylammonium-3D-balls.png

| ImageSizeL2 =

| ImageFileR2 = Pentafluoroxenate-ion-from-xtal-3D-balls.png

| ImageSizeR2 =

| IUPACName = N,N,N-Trimethylmethanaminium pentafluoridoxenonate(−)

| OtherNames = Tetramethylammonium pentafluoroxenate(IV)

| Section1 = {{Chembox Identifiers

| CASNo = 133042-40-7

| PubChem =

| SMILES = C[N+](C)(C)C.F[Xe-](F)(F)(F)F

| StdInChI=1S/C4H12N.F5Xe/c1-5(2,3)4;1-6(2,3,4)5/h1-4H3;/q+1;-1

| StdInChIKey=DNTNABLTOUYNBO-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| Formula = {{chem2|[N(CH3)4][XeF5]}}

| MolarMass = 300.4308 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

{{More citations needed|date=April 2021}}

Tetramethylammonium pentafluoroxenate is a chemical compound with the chemical formula {{chem2|[N(CH3)4]+[XeF5]−}}. This salt consists of tetramethylammonium cations {{chem2|[N(CH3)4]+}} and pentafluoroxenate(IV) anions {{chem2|[XeF5]−}}. The {{chem2|[XeF5]-}} ion was the first example of a pentagonal planar molecular geometry VSEPR theory species.{{cite journal | title = The pentafluoroxenate(IV) anion, {{chem|XeF|5|−}}: the first example of a pentagonal planar AX₅ species | last1= Christe |first1=K. O. |last2=Curtis |first2=E. C. |last3=Dixon |first3=D. A. |last4=Mercier |first4=H. P. |last5=Sanders |first5=J. C. P. |last6=Schrobilgen |first6=G. J. | journal = Journal of the American Chemical Society | year = 1991 | volume = 113 | issue = 9 | pages = 3351–3361 | doi = 10.1021/ja00009a021}} It was prepared by the reaction of Tetramethylammonium fluoride with xenon tetrafluoride, {{chem2|[N(CH3)4]F}} being chosen because it can be prepared in anhydrous form and is readily soluble in organic solvents. The anion is planar, with the fluorine atoms in a slightly distorted pentagonal coordination (Xe–F bond lengths 197.9–203.4 pm, and F–X–F bond angles 71.5°–72.3°). Other salts have been prepared with sodium, caesium and rubidium, and vibrational spectra show that these contain the same planar ion. The isolated anion has the point group of D_5h.

File:Pentafluoroxenate-ion-from-xtal-3D-balls.png File:Pentafluoroxenate-ion-2D.png