:Thunberginol A

{{chembox

| Watchedfields = changed

| verifiedrevid = 442799790

| Name = Thunberginol A

| ImageFile = Thunberginol A.svg

| ImageSize = 200px

| ImageName = Chemical structure of thunberginol A

| ImageAlt = Chemical structure of thunberginol A

| PIN = 3-(3,4-Dihydroxyphenyl)-8-hydroxy-1H-2-benzopyran-1-one

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 147666-80-6

| CASNoOther =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = WK8ZG6DZL6

| PubChem = 5321948

| ChemSpiderID = 4479556

| SMILES = C1=CC2=C(C(=C1)O)C(=O)OC(=C2)C3=CC(=C(C=C3)O)O

| StdInChI = 1S/C15H10O5/c16-10-5-4-8(6-12(10)18)13-7-9-2-1-3-11(17)14(9)15(19)20-13/h1-7,16-18H

| StdInChIKey = WHZXJVJVGGWZQI-UHFFFAOYSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| C=15|H=10|O=5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| GHS_ref =

}}

}}

Thunberginol A is an isocoumarin found in Hydrangea macrophylla{{Cite journal

| last1 = Matsuda | first1 = H.

| last2 = Shimoda | first2 = H.

| last3 = Yamahara | first3 = J.

| last4 = Yoshikawa | first4 = M.

| title = Effects of phyllodulcin, hydrangenol, and their 8-O-glucosides, and thunberginols a and F from Hydrangea macrophylla SERINGE var. Thunbergii MAKINO on passive cutaneous anaphylaxis reaction in rats

| journal = Biological & Pharmaceutical Bulletin

| volume = 22

| issue = 8

| pages = 870–872

| year = 1999

| pmid = 10480329

|id= {{INIST|1959604}} | doi=10.1248/bpb.22.870

| doi-access = free

}} and the herbal preparation hydrangeae dulcis folium which is produced from its leaves.{{Cite journal

| last1 = Yamahara | first1 = J.

| last2 = Matsuda | first2 = H.

| last3 = Shimoda | first3 = H.

| last4 = Wariishi | first4 = N.

| last5 = Yagi | first5 = N.

| last6 = Murakami | first6 = N.

| last7 = Yoshikawa | first7 = M.

| title = Effects of thunberginol a contained in Hydrangeae dulcis forium on types I-IV allergies

| journal = Nihon Yakurigaku Zasshi. Folia Pharmacologica Japonica

| volume = 105

| issue = 5

| pages = 365–379

| year = 1995

| doi = 10.1254/fpj.105.365

| pmid = 7628785

| language=ja

| doi-access = free

}}

{{Cite journal | last1 = Matsuda | first1 = H. | last2 = Shimoda | first2 = H. | last3 = Yamahara | first3 = J. | last4 = Yoshikawa | first4 = M. | title = Immunomodulatory activity of thunberginol a and related compounds isolated from hydrangeae dulcis folium on splenocyte proliferation activated by mitogens | doi = 10.1016/S0960-894X(97)10221-9 | journal = Bioorganic & Medicinal Chemistry Letters | volume = 8 | issue = 3 | pages = 215–20 | year = 1998 | pmid = 9871657}}

References

{{Reflist}}

{{Isocoumarin}}

Category:Isocoumarins

{{phenol-stub}}