:Thunberginol A
{{chembox
| Watchedfields = changed
| verifiedrevid = 442799790
| Name = Thunberginol A
| ImageFile = Thunberginol A.svg
| ImageSize = 200px
| ImageName = Chemical structure of thunberginol A
| ImageAlt = Chemical structure of thunberginol A
| PIN = 3-(3,4-Dihydroxyphenyl)-8-hydroxy-1H-2-benzopyran-1-one
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 147666-80-6
| CASNoOther =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = WK8ZG6DZL6
| PubChem = 5321948
| ChemSpiderID = 4479556
| SMILES = C1=CC2=C(C(=C1)O)C(=O)OC(=C2)C3=CC(=C(C=C3)O)O
| StdInChI = 1S/C15H10O5/c16-10-5-4-8(6-12(10)18)13-7-9-2-1-3-11(17)14(9)15(19)20-13/h1-7,16-18H
| StdInChIKey = WHZXJVJVGGWZQI-UHFFFAOYSA-N
| MeSHName =
}}
|Section2={{Chembox Properties
| C=15|H=10|O=5
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
| GHS_ref =
}}
}}
Thunberginol A is an isocoumarin found in Hydrangea macrophylla{{Cite journal
| last1 = Matsuda | first1 = H.
| last2 = Shimoda | first2 = H.
| last3 = Yamahara | first3 = J.
| last4 = Yoshikawa | first4 = M.
| title = Effects of phyllodulcin, hydrangenol, and their 8-O-glucosides, and thunberginols a and F from Hydrangea macrophylla SERINGE var. Thunbergii MAKINO on passive cutaneous anaphylaxis reaction in rats
| journal = Biological & Pharmaceutical Bulletin
| volume = 22
| issue = 8
| pages = 870–872
| year = 1999
| pmid = 10480329
|id= {{INIST|1959604}} | doi=10.1248/bpb.22.870
| doi-access = free
}} and the herbal preparation hydrangeae dulcis folium which is produced from its leaves.{{Cite journal
| last1 = Yamahara | first1 = J.
| last2 = Matsuda | first2 = H.
| last3 = Shimoda | first3 = H.
| last4 = Wariishi | first4 = N.
| last5 = Yagi | first5 = N.
| last6 = Murakami | first6 = N.
| last7 = Yoshikawa | first7 = M.
| title = Effects of thunberginol a contained in Hydrangeae dulcis forium on types I-IV allergies
| journal = Nihon Yakurigaku Zasshi. Folia Pharmacologica Japonica
| volume = 105
| issue = 5
| pages = 365–379
| year = 1995
| doi = 10.1254/fpj.105.365
| pmid = 7628785
| language=ja
| doi-access = free
{{Cite journal | last1 = Matsuda | first1 = H. | last2 = Shimoda | first2 = H. | last3 = Yamahara | first3 = J. | last4 = Yoshikawa | first4 = M. | title = Immunomodulatory activity of thunberginol a and related compounds isolated from hydrangeae dulcis folium on splenocyte proliferation activated by mitogens | doi = 10.1016/S0960-894X(97)10221-9 | journal = Bioorganic & Medicinal Chemistry Letters | volume = 8 | issue = 3 | pages = 215–20 | year = 1998 | pmid = 9871657}}