:Thunberginol E

{{chembox

| Watchedfields = changed

| verifiedrevid = 442187006

| Name = Thunberginol E

| ImageFile = Thunberginol E.svg

| ImageSize = 200px

| ImageName = Chemical structure of thunberginol E

| ImageAlt = Chemical structure of thunberginol E

| IUPACName = (3R)-6,8-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-3,4-dihydroisochromen-1-one

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 147517-08-6

| CASNo_Ref = {{cascite|correct|??}}

| CASNoOther =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 77N5TN6EJP

| PubChem = 10040569

| SMILES = COC1=C(C=C(C=C1)C2CC3=CC(=CC(=C3C(=O)O2)O)O)O

| ChemSpiderID = 57448109

| StdInChI = 1S/C16H14O6/c1-21-13-3-2-8(5-11(13)18)14-6-9-4-10(17)7-12(19)15(9)16(20)22-14/h2-5,7,14,17-19H,6H2,1H3

| StdInChIKey = MZKMQBPFGDJUFV-UHFFFAOYSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| Formula = C₁₆H₁₄O₆

| MolarMass = 302.27 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Thunberginol E is a dihydroisocoumarin found in Hydrangeae Dulcis Folium, the processed leaves of Hydrangea macrophylla var. thunbergii.{{Cite journal

| last1 = Yoshikawa | first1 = M.

| last2 = Uchida | first2 = E.

| last3 = Chatani | first3 = N.

| last4 = Kobayashi | first4 = H.

| last5 = Naitoh | first5 = Y.

| last6 = Okuno | first6 = Y.

| last7 = Matsuda | first7 = H.

| last8 = Yamahara | first8 = J.

| last9 = Murakami | first9 = N.

| title = Thunberginols C, D, and E, New Antiallergic and Antimicrobial Dihydroisocoumarins, and Thunberginol G 3'-O-Glucoside and (-)-Hydrangenol 4'-O-Glucoside, New Dihydroisocoumarin Glycosides, from Hydrangeae Dulcis Folium

| journal = Chemical and Pharmaceutical Bulletin

| volume = 40

| issue = 12

| pages = 3352–3354

| year = 1992

| pmid = 1363465

| doi = 10.1248/cpb.40.3352

| url = http://www.jstage.jst.go.jp/article/cpb1958/40/12/40_12_3352/_pdf

| format = pdf

| doi-access = free

}}