:Tiflorex

{{Short description|Never marketed appetite suppressant}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 449587989

| IUPAC_name = (RS)-N-ethyl-1-{3-[(trifluoromethyl)thio]phenyl}propan-2-amine

| image = Tiflorex standardized.png

| image_class = skin-invert-image

| width = 260px

| chirality = Racemic mixture

| drug_name =

| tradename =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 53993-67-2

| ATC_prefix = none

| PubChem = 173669

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = EG3B69DFQ5

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 151574

| C=12 | H=16 | F=3 | N=1 | S=1

| synonyms =

| smiles = CCNC(C)Cc1cccc(c1)SC(F)(F)F

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C12H16F3NS/c1-3-16-9(2)7-10-5-4-6-11(8-10)17-12(13,14)15/h4-6,8-9,16H,3,7H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = HNONSDNCRNUTCT-UHFFFAOYSA-N

}}

Tiflorex (TFX), formerly known as flutiorex, is a stimulant{{citation needed|date=July 2023}} amphetamine that was under development as an appetite suppressant in the 1970s,{{cite journal | vauthors = Giudicelli JF, Richer C, Berdeaux A | title = Preliminary assessment of flutiorex, a new anorectic drug, in man | journal = British Journal of Clinical Pharmacology | volume = 3 | issue = 1 | pages = 113–21 | date = February 1976 | pmid = 788737 | pmc = 1428817 | doi = 10.1111/j.1365-2125.1976.tb00578.x }}{{cite journal | vauthors = Silverstone T, Fincham J, Plumley J | title = An evaluation of the anorectic activity in man of a sustained release formulation of tiflorex | journal = British Journal of Clinical Pharmacology | volume = 7 | issue = 4 | pages = 353–6 | date = April 1979 | pmid = 444355 | pmc = 1429648 | doi = 10.1111/j.1365-2125.1979.tb00945.x }} but appears to have been abandoned. It is structurally related to fenfluramine and 4-MTA.

Tiflorex went to phase II clinical trials. The extended release formulation "TFX-SR" produced significant suppression of appetite. It also caused slightly more sleep disturbances and headaches than placebo, as well as mydriasis and a self-reported decrease in arousal. It had little effect on heart rate.

Tifluorex is claimed to be a more potent anorectic than fenfluramine, with twice its potency in humans and 4 times its potency in rats.{{Cite book | url=https://books.google.com/books?id=z_8kBQAAQBAJ&pg=PA356 |title = Abstracts: Sixth International Congress of Pharmacology|isbn = 9781483152530|last1 = Stuart|first1 = Sam |date = 2013-09-11| publisher=Elsevier }}