Α-Phenylcinnamic acid

{{lowercase title}}

{{Chembox

|Verifiedfields = changed

|Watchedfields = changed

|verifiedrevid = 477319601

|Name = α-Phenycinnamic acid

|ImageFile = Alpha-Phenylcinnamic_acid.png

|ImageSize = 150

|ImageAlt = Skeletal formula

|ImageFile1 = Alpha-Phenylcinnamic-acid-3D-balls.png

|ImageAlt1 = Ball-and-stick model

|PIN = (2E)-2,3-Diphenylprop-2-enoic acid

|OtherNames = α-Phenylcinnamic acid, α-(Phenylmethylene)benzeneacetic acid, α-Phenyl-trans-cinnamic acid

|Section1={{Chembox Identifiers

|ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

|ChemSpiderID = 610577

|PubChem = 700620

|EC_number = 202-069-4

|InChI = 1/C15H12O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H,16,17)/b14-11+

|InChIKey = BIDDLDNGQCUOJQ-SDNWHVSQBV

|SMILES1 = O=C(O)\C(=C\c1ccccc1)c2ccccc2

|StdInChI_Ref = {{stdinchicite|correct|chemspider}}

|StdInChI = 1S/C15H12O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H,16,17)/b14-11+

|StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

|StdInChIKey = BIDDLDNGQCUOJQ-SDNWHVSQSA-N

|CASNo_Ref = {{cascite|correct|CAS}}

|CASNo = 91-48-5

|UNII_Ref = {{fdacite|correct|FDA}}

|UNII = 0PKH62904B

|SMILES = OC(=O)C(=C/C1=CC=CC=C1)/C2=CC=CC=C2}}

|Section2={{Chembox Properties

|C=15 | H=12 | O=2

|Appearance = White to light yellow powder

|MeltingPtC = 172 to 174

|BoilingPtC = 224 to 225

|Solubility = Slightly soluble}}

|Section3={{Chembox Hazards

|MainHazards = Irritanthttp://msds.chem.ox.ac.uk/PH/alpha-phenyl_cinnamic_acid.html {{Dead link|date=August 2022}}

|GHSPictograms = {{GHS07}}

|GHSSignalWord = Warning

|HPhrases = {{H-phrases|315|319|335}}

|PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}

}}

}}

α-Phenylcinnamic acid is a phenylpropanoid, or, more specifically, a derivative of cinnamic acid. It has the formula C15H12O2 and appears as an off-white crystalline solid.{{Cite web|url=http://www.chemexper.com/search/cas/91485.html|title = ChemExper}}

Uses

α-Phenylcinnamic acid is frequently used as a compound synthesized in undergraduate laboratories to study the Perkin reaction, but is primarily seen as in intermediate or precursor to other, more useful phenylpropanoids.

Synthesis

There are many ways to synthesize α-phenylcinnamic acid. Some of the more popular methods of formation include the condensation of phenacyl chloride with benzaldehyde in the presence of triethylamine, the distillation of benzylmandelic acid, or by the reaction of sodium phenylacetate with benzaldehyde in acetic anhydride.Organic Syntheses, Coll. Vol. 4, p.777 (1963); Vol. 33, p.70 (1953).[http://www.orgsyn.org/demo.aspx?prep=cv4p0777 Link] There are two isomers of this compound, differing in the geometry of the alkene. The E isomer, in which the two phenyl rings are cis to each other, is the major product formed by most synthetic routes. However, this compound can be converted using heat or ultraviolet light into a mixture containing nearly 50% of the Z isomer.{{cite web |url= http://www.ch.ic.ac.uk/ectoc/papers/45/ECTCIN.html |title= Experimental and Computational Tools for Mechanistic Study: A Modified Perkin Condensation leading to Alpha-Phenylcinnamic Acid Isomers |author1=István Pálinkó |author2=Béla Török |author3=Gyula Tasi |author4=Tamás Körtvélyesi |publisher= Electronic Conferences on Trends in Organic Chemistry: ECTOC-1: June 12-July 7, 1995 }} Decarboxylation of α-phenylcinnamic acid yields stilbene, with the (E) isomer producing cis-stilbene and the (Z)-isomer producing trans-stilbene.{{OrgSynth|first1 = Robert E.|last1 = Buckles|first2 = Norris G.|last2 = Wheeler|title = cis-Stilbene|year = 1953|volume = 33|pages = 88|doi = 10.15227/orgsyn.033.0088|prep = CV4P0857|collvol = 4|collvolpages = 857}}

References

{{reflist}}

{{DEFAULTSORT:Phenylcinnamic Acid, α-}}

Category:Enones