Β-Hydroxythiofentanyl

{{Short description|Opioid analgesic drug}}

{{lowercasetitle}}

{{Drugbox

| drug_name = β-Hydroxythiofentanyl

| verifiedrevid = 410873709

| IUPAC_name = N-{1-[2-Hydroxy-2-(thiophen-2-yl)ethyl]piperidin-4-yl}-N-phenylpropanamide

| image = Betahydroxythiofentanyl.svg

| width = 200px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA = Schedule I

| legal_UK = Class A

| legal_US = Schedule I

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 1474-34-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = MG6JW60TUG

| ATC_prefix = none

| ATC_suffix =

| PubChem = 62278

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 21106268

| C=20 | H=26 | N=2 | O=2 | S=1

| smiles = CCC(=O)N(c1ccccc1)C2CCN(CC2)CC(c3cccs3)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H26N2O2S/c1-2-20(24)22(16-7-4-3-5-8-16)17-10-12-21(13-11-17)15-18(23)19-9-6-14-25-19/h3-9,14,17-18,23H,2,10-13,15H2,1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = GLAAETOTOUGGSB-UHFFFAOYSA-N

| synonyms =

}}

β-Hydroxythiofentanyl (beta-hydroxythiofentanyl) is an opioid analgesic that is an analog of fentanyl and thiofentanyl.

β-Hydroxythiofentanyl was sold briefly on the black market from around 1985,Valter K, Arrizabalaga P. Designer Drugs Directory (1998), p150. {{ISBN|0-444-20525-X}} before the introduction of the Federal Analog Act in 1986 which for the first time attempted to control entire families of drugs based on their structural similarity rather than scheduling each drug individually as they appeared.{{cite journal | vauthors = Henderson GL | year = 1988 | title = Designer Drugs: Past History and Future Prospects | journal = Journal of Forensic Sciences | volume = 33 | issue = 2| pages = 569–575 | doi = 10.1520/JFS11976J | pmid = 3286815 }} β-hydroxythiofentanyl was anecdotally said to be one of the more favored fentanyl analogs by opiate addicts{{cn|date=October 2023}}.