1,3-Benzodioxolylpentanamine

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name = BDP

| image = BDP structure.png

| width = 200px

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 220491-69

| CAS_supplemental =

| PubChem = 22007048

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 13616549

| UNII =

| KEGG =

| ChEBI =

| ChEMBL =

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = 1-(3,4-Methylenedioxyphenyl)-2-aminopentane; 3,4-Methylenedioxy-α-propylphenethylamine; MDPPEA; α-Propyl-1,3-benzodioxole-5-ethanamine; α-Propyl-3,4-methylenedioxyphenethylamine; α-Pr-MDPEA; 2-Amino-1-(3,4-methylenedioxyphenyl)pentane

| IUPAC_name = 1-(1,3-benzodioxol-5-yl)pentan-2-amine

| C=12 | H=17 | N=1 | O=2

| SMILES = CCCC(CC1=CC2=C(C=C1)OCO2)N

| StdInChI = 1S/C12H17NO2/c1-2-3-10(13)6-9-4-5-11-12(7-9)15-8-14-11/h4-5,7,10H,2-3,6,8,13H2,1H3

| StdInChIKey = BWUFCVGRQFOTOA-UHFFFAOYSA-N

}}

1,3-Benzodioxolylpentanamine (BDP), also known as K or as 3,4-methylenedioxy-α-propylphenethylamine (MDPPEA), is a drug of the phenethylamine and amphetamine families.{{cite book | vauthors = Shulgin AT, Shulgin A |url= https://www.erowid.org/library/books_online/pihkal/ |title=PiHKAL: A Chemical Love Story |date=1991 |publisher=Transform Press |isbn=9780963009609 |edition=1st |location=Berkeley, CA |oclc=25627628}}{{cite book | vauthors = Shulgin A, Manning T, Daley PF | title=The Shulgin Index, Volume One: Psychedelic Phenethylamines and Related Compounds | publisher=Transform Press | location=Berkeley | volume=1 | year=2011 | isbn=978-0-9630096-3-0 }}{{cite book | vauthors = Trachsel D, Lehmann D, Enzensperger C | title=Phenethylamine: von der Struktur zur Funktion | trans-title = Phenethylamines: From Structure to Function | publisher=Nachtschatten-Verlag | location=Solothurn | series=Nachtschatten-Science | year=2013 | isbn=978-3-03788-700-4 | oclc=858805226 | url=https://books.google.com/books?id=-Us1kgEACAAJ | language=de | access-date=29 January 2025 | page=556 }} It is the parent compound of 1,3-benzodioxolyl-N-methylpentanamine (MBDP; methyl-K) and 1,3-benzodioxolyl-N-ethylpentanamine (EBDP; ethyl-K), as well as of pentylone (βk-MBDP). The drug was synthesized by Alexander Shulgin and described in PiHKAL. In contrast to MBDP and EBDP however, it is not known to have ever been tried by humans. Very little is known about BDP.