1,4-Dimethoxybenzene

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477206259

| Name = 1,4-Dimethoxybenzene

| ImageFileL1 = P-Dimethoxybenzene.svg

| ImageSizeL1 = 100

| ImageFileR1 = 1,4-Dimethoxybenzene-3D-balls.png

| ImageAltR1 = 1,4-Dimethoxybenzene molecule

| PIN = 1,4-Dimethoxybenzene

| OtherNames = Hydroquinone dimethyl ether; p-Methoxyanisole; Dimethyl ether hydroquinone; USAF AN-9; Dimethylhydroquinone ether; Quinol dimethyl ether; p-Dimethoxybenzene

|Section1={{Chembox Identifiers

| SMILES = COc1ccc(OC)cc1

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 21105878

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 24WC6T6X0G

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 150-78-7

| RTECS = CZ6650000

| EINECS = 205-771-9

| PubChem = 9016

| ChEMBL = 1668604

| StdInChI=1S/C8H10O2/c1-9-7-3-5-8(10-2)6-4-7/h3-6H,1-2H3

| StdInChIKey = OHBQPCCCRFSCAX-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=8 | H=10 | O=2

| Appearance = White crystals

| Odor = sweet, nut-like

| Solubility = Slightly soluble

| SolubleOther = very soluble in ether, benzene
soluble in acetone

| MeltingPtC = 54 to 56

| MeltingPt_ref = [http://www.sigmaaldrich.com/catalog/product/aldrich/d131350?lang=en®ion=US&cm_sp=Insite-_-prodRecCold_xviews-_-prodRecCold10-1] at Sigma-Aldrich

| BoilingPtC = 212.6

| BoilingPt_ref =

| Viscosity = 1.04 cP at 65 °C

| Density = 1.035 g/cm{{sup|3}}{{GESTIS|ZVG=23680}}

| LogP = 2.03

| MagSus = −86.65·10{{sup|−6}} cm{{sup|3}}/mol

}}

|Section3={{Chembox Structure

| MolShape = Planar

}}

|Section7={{Chembox Hazards

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|319|335}}

| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}

| FlashPtC = 94

| FlashPt_ref =

| AutoignitionPtC = 795

| AutoignitionPt_ref =

| ExploLimits = 1.2-56%

}}

|Section8={{Chembox Related

| OtherFunction_label = hydrocarbons, ethers

| OtherFunction =

| OtherCompounds = 1,2-Dimethoxybenzene; 1,3-Dimethoxybenzene

}}

}}

1,4-Dimethoxybenzene is an organic compound with the formula C{{sub|6}}H{{sub|4}}(OCH{{sub|3}}){{sub|2}}. It is one of three isomers of dimethoxybenzene. It is a white solid with an intensely sweet floral odor. It is produced by several plant species.Karl-Georg Fahlbusch, Franz-Josef Hammerschmidt, Johannes Panten, Wilhelm Pickenhagen, Dietmar Schatkowski, Kurt Bauer, Dorothea Garbe and Horst Surburg "Flavors and Fragrances" in Ullmann's Encyclopedia of Industrial Chemistry, 2003, Wiley-VCH. {{doi|10.1002/14356007.a11_141}}