1D-LSD

{{Use dmy dates|date=October 2024}}

{{Chembox

| ImageFile = 1D-LSD.svg

| ImageSize = 180px

| ImageAlt =

| IUPACName = (8β)-1-(1,2-Dimethylcyclobutane-1-carbonyl)-N,N-diethyl-6-methyl-9,10-didehydroergoline-8-carboxamide

| OtherNames = 1-(1,2-Dimethylcyclobutane-1-carbonyl)-lysergic acid diethylamide

| Section1 = {{Chembox Identifiers

| CASNo =

| PubChem = 170703347

| SMILES = [H][C@@]12CC3=CN(C(=O)C4(C)CCC4C)C4=C3C(=CC=C4)C1=C[C@H](CN2C)C(=O)N(CC)CC

| StdInChI=1S/C27H35N3O2/c1-6-29(7-2)25(31)19-13-21-20-9-8-10-22-24(20)18(14-23(21)28(5)15-19)16-30(22)26(32)27(4)12-11-17(27)3/h8-10,13,16-17,19,23H,6-7,11-12,14-15H2,1-5H3/t17?,19-,23-,27?/m1/s1

| StdInChIKey = RNVFVHAKGPSAIU-ZRCBXKLVSA-N

}}

| Section2 = {{Chembox Properties

| C = 27 | H = 35 | N = 3 | O = 2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

1D-LSD (1-(1,2-dimethylcyclobutane-1-carbonyl)-lysergic acid diethylamide, SYN-L-229) is a psychotropic substance and a research chemical that has potential psychedelic effects. It is believed to be a prodrug for LSD and has replaced 1V-LSD in Germany after 1V-LSD became covered by the German NpSG law in 2022.{{cite web |type=Video|work=Sky News|date=13 June 2024|location=Germany|title=Stuttgart: LSD variant being sold in German vending machine due to legal loophole|url=https://news.sky.com/video/stuttgart-lsd-variant-being-sold-in-german-vending-machine-due-to-legal-loophole-13152534}} It is also available as tartrate and liquid.{{cn|date=April 2024}}

Legality

= Germany =

Since the 14 June 2024 1D-LSD (and 1T-LSD) are covered by the German NpSG law.

= Austria =

According to the current legal situation, 1D-LSD is neither explicitly mentioned in the [https://www.sozialministerium.at/Themen/Gesundheit/Drogen-und-Sucht/Suchtmittel-NPS-Drogenausgangsstoffe/Rechtliche-Informationen/Suchtgiftverordnung.html Narcotic Drugs Ordinance] nor in the [https://www.apothekerkammer.at/infothek/rechtliche-informationen/suchtmittelrecht/psychotropenverordnung-pv Psychotropic Substances Ordinance] (SV/PV), thus it is neither to be classified as a narcotic drug in the sense of the SV nor as a psychotropic substance in the sense of the PV.

See also

References

{{Reflist}}

{{Psychedelics}}

{{Serotonin receptor modulators}}

{{Ergolines}}

Category:5-HT2A agonists

Category:Cyclobutanes

Category:Designer drugs

Category:Prodrugs

Category:Psychedelic lysergamides

{{hallucinogen-stub}}