1cP-LSD

{{Short description|Chemical compound}}

{{Drugbox

| drug_name = 1cP-LSD

| IUPAC_name = (6aR,9R)-N,N-diethyl-7-methyl-4-cyclopropylmethanoyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide

| image = 1CP-LSD_structure.svg

| width = 220

| tradename =

| legal_AU = S9

| legal_BR = F2

| legal_CA = Unscheduled.

| legal_DE = NpSG

| legal_UK = PSA

| dependency_liability = Low

| addiction_liability = None

| routes_of_administration = By mouth, under the tongue

| onset = 30 - 60 minutes

| duration_of_action = 8 - 24 hours

| CAS_number = 2767597-50-0

| PubChem = 155884675

| UNII = 7UU7S6TN3J

| synonyms = 1cP, acid, LSD, Lucy

| ChemSpiderID = 107450612

| C = 24

| H = 29

| N = 3

| O = 2

| smiles = CCN(CC)C(=O)[C@@H]5C=C2[C@@H](Cc3cn(C(=O)C1CC1)c4cccc2c34)N(C)C5

| StdInChI = 1S/C24H29N3O2/c1-4-26(5-2)23(28)17-11-19-18-7-6-8-20-22(18)16(12-21(19)25(3)13-17)14-27(20)24(29)15-9-10-15/h6-8,11,14-15,17,21H,4-5,9-10,12-13H2,1-3H3/t17-,21-/m1/s1

| StdInChIKey = RAFUPYYDHPFASC-DYESRHJHSA-N

}}

1cP-LSD (N1-(cyclopropylmethanoyl)-lysergic acid diethylamide) is an acylated derivative of lysergic acid diethylamide (LSD), which has been sold as a designer drug.

{{cite journal | vauthors = Tanaka R, Kawamura M, Hakamatsuka T, Kikura-Hanajiri R | title = [Identification of LSD Derivatives, 1cP-LSD, MIPLA and 1B-LSD in Illegal Products as Paper Sheet] | journal = Yakugaku Zasshi | year = 2020 | volume = 140 | issue = 11 | pages = 1405–1413 | pmid = 33132277 | doi = 10.1248/yakushi.20-00124 | doi-access = free }}{{cite journal | vauthors = Vincenti F, Gregori A, Flammini M, Di Rosa F, Salomone A | title = Seizures of New Psychoactive Substances on the Italian territory during the COVID-19 pandemic | journal = Forensic Science International | volume = 326 | issue = | pages = 110904 | date = July 2021 | pmid = 34371393 | doi = 10.1016/j.forsciint.2021.110904 | pmc = 8411784 }} It was first synthesized as a legal-LSD alternative by Lizard Labs, a Netherlands based research chemical laboratory.{{Cite web |last=spotlight |date=2018-07-25 |title=About Us - Lizard Labs |url=https://lizardlabs.nl/about-us/ |access-date=2024-09-13 |website=lizardlabs.nl |language=en-GB}} In tests on mice it was found to be an active psychedelic with similar potency to 1P-LSD.{{cite journal | vauthors = Brandt SD, Kavanagh PV, Westphal F, Stratford A, Odland AU, Klein AK, Dowling G, Dempster NM, Wallach J, Passie T, Halberstadt AL | display-authors = 6 | title = Return of the lysergamides. Part VI: Analytical and behavioural characterization of 1-cyclopropanoyl-d-lysergic acid diethylamide (1CP-LSD) | journal = Drug Testing and Analysis | volume = 12 | issue = 6 | pages = 812–826 | date = June 2020 | pmid = 32180350 | doi = 10.1002/dta.2789 | pmc = 9191646 }}