2,6-Dihydroxybenzoic acid

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477198258

| Name = 2,6-Dihydroxybenzoic acid

| ImageFile = 2,6-Dihydroxybenzoesäure.svg

| ImageSize = 200px

| ImageName = Chemical structure of 2,6-dihydroxybenzoic acid

| ImageAlt = Chemical structure of 2,6-dihydroxybenzoic acid

| PIN = 2,6-Dihydroxybenzoic acid

| OtherNames = γ-Resorcylic acid
2-Carboxyresorcinol
2,6-Resorcylic acid

|Section1={{Chembox Identifiers

| CASNo = 303-07-1

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNoOther =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = RSA5G6VRPV

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 454808

| PubChem = 9338

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8974

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C7H6O4/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,8-9H,(H,10,11)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = AKEUNCKRJATALU-UHFFFAOYSA-N

| SMILES = C1=CC(=C(C(=C1)O)C(=O)O)O

| InChI =

| MeSHName =

}}

|Section2={{Chembox Properties

| Formula = C₇H₆O₄

| MolarMass = 154.12 g/mol

| Appearance =

| Density =

| MeltingPtC = 171

| MeltingPt_ref={{cite book |ref=Haynes| editor= Haynes, William M. | date = 2016| title = CRC Handbook of Chemistry and Physics | edition = 97th | publisher = CRC Press | isbn = 9781498754293|page=3.190}}

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt=

| GHSPictograms =

| GHSSignalWord =

| HPhrases = {{HPhrases|}}

| PPhrases = {{PPhrases|}}

| GHS_ref = GHS: [https://www.sigmaaldrich.com/product/ALDRICH/D109606 Sigma-Aldrich D109606] "Not a hazardous substance or mixture according to Regulation (EC) No. 1272/2008"

}}

}}

2,6-Dihydroxybenzoic acid (γ-resorcylic acid) is a dihydroxybenzoic acid.