2-Nitronaphthalene

{{Chembox

| ImageFile = 2-nitronaphthalene 200.svg

| ImageSize =

| ImageAlt =

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 581-89-5

| CASNo_Ref = {{Cascite|changed|CAS}}

| Beilstein = 2046354

| ChEBI = 50637

| ChEMBL = 353064

| ChemSpiderID = 10914

| EC_number = 209-474-5

| KEGG = C19474

| PubChem = 11392

| RTECS = QJ9760000

| UNNumber = 2538

| UNII = V5NB52B64Q

| StdInChI=1S/C10H7NO2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H

| StdInChIKey = ZJYJZEAJZXVAMF-UHFFFAOYSA-N

| SMILES = C1=CC=C2C=C(C=CC2=C1)[N+](=O)[O-]

}}

|Section2={{Chembox Properties

| C=10|N=1|O=2|H =7

| MolarMass =

| Appearance = colorless solid

| Density = 1,31 g·cm−3

| MeltingPtC = 79

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| GHS_ref={{cite web |title=2-Nitronaphthalene |url=https://pubchem.ncbi.nlm.nih.gov/compound/11392#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |language=en}}

| GHSPictograms = {{GHS08}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|350|411}}

| PPhrases = {{P-phrases|203|273|280|318|391|405|501}}

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

2-Nitronaphthalene is an organic compound with the formula {{Chem2|C10H7NO2}}. It is one of two isomers of nitronaphthalene, the other being 1-nitronaphthalene. 2-Nitronaphthalene is produced in very low yields upon nitration of naphthalene, but it can be more efficiently obtained via the diazotization of 2-aminonaphthalene.{{Ullmann |doi=10.1002/14356007.a17_411|title=Nitro Compounds, Aromatic |year=2000 |last1=Booth |first1=Gerald |isbn=3527306730 }}

References

{{DEFAULTSORT:Nitronaphthalene, 2-}}

Category:Nitronaphthalenes

Category:2-Naphthyl compounds