25iP-NBOMe
{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc}}
{{Drugbox
| verifiedrevid =
| IUPAC_name = 2-(2,5-Dimethoxy-4-propan-2-ylphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine
| image = 25iP-NBOMe.svg
| width = 200px
| tradename =
| pregnancy_category =
| routes_of_administration =
| legal_DE = NpSG
| legal_UK = Class A
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 1391487-83-4
| CAS_supplemental =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 575702U55U
| ATC_prefix = none
| PubChem = 118796426
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 52085379
| C=21 | H=29 | N=1 | O=3
| smiles = CC(C)C1=C(C=C(C(=C1)OC)CCNCC2=CC=CC=C2OC)OC
| StdInChI = 1S/C21H29NO3/c1-15(2)18-13-20(24-4)16(12-21(18)25-5)10-11-22-14-17-8-6-7-9-19(17)23-3/h6-9,12-13,15,22H,10-11,14H2,1-5H3
| StdInChIKey = KMZZEEDFQLXSQF-UHFFFAOYSA-N
}}
25iP-NBOMe (2C-iP-NBOMe, NBOMe-2C-iP) is a derivative of the phenethylamine hallucinogen 2C-iP, which acts as a highly potent agonist for the human 5-HT2A receptor.{{cite journal | journal = Clinical Toxicology | title = Prevalence of use and acute toxicity associated with the use of NBOMe drugs | vauthors = David W, Roumen S, Andrew C, Paul D |url=https://www.tandfonline.com/doi/abs/10.3109/15563650.2015.1004179 | doi = 10.3109/15563650.2015.1004179 | date = 6 February 2015 | pages = 85–92 | volume = 53 | issue = 2 | pmid = 25658166| s2cid = 25752763 }}
Toxicity and harm potential
{{Excerpt | 25-NB | Toxicity and harm potential}}
=Neurotoxic and cardiotoxic actions=
{{Excerpt | 25-NB | Neurotoxic and cardiotoxic actions}}
=Emergency treatment=
{{Excerpt | 25-NB | Emergency treatment}}
Legality
=United Kingdom=
{{N-benzylphenethylamine-Legality-United Kingdom}}
Notes
{{notelist}}
References
{{Reflist}}
{{Psychedelics}}
{{Serotonergics}}
{{Phenethylamines}}