3-Allylfentanyl
{{Short description|Opioid analgesic}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 477217912
| IUPAC_name = N-[(3S,4R)-1-Phenethyl-3-prop-2-enylpiperidin-4-yl]-N-phenylpropanamide
| image = 3-allylfentanyl.svg
| width = 160
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US = Schedule I{{cite journal | author = Drug Enforecement Administration, Department of Justice | title = Schedules of Controlled Substances:Temporary Placement of Fentanyl-Related Substances in Schedule I. Temporary amendment; temporary scheduling order | journal = Federal Register | volume = 83 | issue = 25 | pages = 5188–92 | date = February 2018 | pmid = 29932611 }}
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 86151-80-6
| ATC_prefix =
| ATC_suffix =
| PubChem = 133866
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 118047
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = V990X77S2I
| C=25 | H=32 | N=2 | O=1
| smiles = O=C(N(c1ccccc1)[C@@H]3CCN(CCc2ccccc2)C[C@@H]3C\C=C)CC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C25H32N2O/c1-3-11-22-20-26(18-16-21-12-7-5-8-13-21)19-17-24(22)27(25(28)4-2)23-14-9-6-10-15-23/h3,5-10,12-15,22,24H,1,4,11,16-20H2,2H3/t22-,24+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = BZXKQFFMDLTPJL-LADGPHEKSA-N
| synonyms =
}}
3-Allylfentanyl is an opioid analgesic that is an analogue of fentanyl.
|assign2= |url=https://patents.google.com/patent/USRE33495}} has effects similar to fentanyl, although it is only 0.13x-0.14x as potent by weight.{{cite journal | vauthors = Casy AF, Ogungbamila FO | title = 3-Allyl analogues of fentanyl | journal = The Journal of Pharmacy and Pharmacology | volume = 34 | issue = 3 | pages = 210 | date = March 1982 | pmid = 6121908 | doi = 10.1111/j.2042-7158.1982.tb04229.x | s2cid = 41011062 }}
The decreased potency of this analogue caused by the addition of the allyl group makes it somewhat less dangerous than fentanyl itself (ED50(rat) of 80μg/kg vs 11μg/kg for fentanyl), although this is relative. For comparison, carfentanil is at least 20-30x as potent as fentanyl.
Side Effects
Side effects of fentanyl analogs vary based on strength and are similar to those of fentanyl itself, which include itching, nausea and potentially serious respiratory depression, which can be life-threatening.
See also
References
{{Reflist}}
{{Opioidergics}}
{{DEFAULTSORT:Allylfentanyl, 3-}}
Category:Mu-opioid receptor agonists
{{analgesic-stub}}