3152 CT

{{Chembox

| Name = 3152 CT

| ImageFile= 3152 CT.png

| Section1 = {{Chembox Identifiers

| SMILES = [NH3+]c(c1)cccc1OCCCOc(cc([NH3+])c2)cc2OC(=O)N(C)C.[I-].[I-]

| StdInChI=1S/C18H23N3O4.2HI/c1-21(2)18(22)25-17-11-14(20)10-16(12-17)24-8-4-7-23-15-6-3-5-13(19)9-15;;/h3,5-6,9-12H,4,7-8,19-20H2,1-2H3;2*1H

| StdInChIKey=KDBKYZAHSYSXLC-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| C=24 | H=37 | N=3 | I=2 | O=4

| Appearance = Solid

| MeltingPtC = 182-184

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| LD50 = 16 μg/kg (intravenous, mice){{cite web |title=Method for methylating and quaternizing |url=https://patents.google.com/patent/US3903135A/en}}
8 μg/kg (intravenous, rabbits)

}}

}}

3152 CT is an extremely toxic bisquaternary carbamate with powerful anticholinesterase action.{{cite journal |last1=LEVIN |first1=AP |last2=JANDORF |first2=BJ |title=Inactivation of cholinesterase by compounds related to neostigmine. |journal=The Journal of Pharmacology and Experimental Therapeutics |date=February 1955 |volume=113 |issue=2 |pages=206–11 |pmid=13234044}}