3C-MAL

{{Short description|Chemical compound}}

{{Infobox drug

| image = 3C-MAL.png

| IUPAC_name = 1-[3,5-dimethoxy-4-(2-methylprop-2-enoxy)phenyl]propan-2-amine

| tradename =

| PubChem = 54929000

| ChemSpiderID = 33248744

| CAS_number = 501700-11-4

| C=15 | H=23 | N=1 | O=3

| smiles = CC(CC1=CC(=C(C(=C1)OC)OCC(=C)C)OC)N

| StdInChI = 1S/C15H23NO3/c1-10(2)9-19-15-13(17-4)7-12(6-11(3)16)8-14(15)18-5/h7-8,11H,1,6,9,16H2,2-5H3

| StdInChIKey = PUSUEDYGABXNSF-UHFFFAOYSA-N

}}

3C-MAL (4-Methylallyloxy-3,5-dimethoxyamphetamine) is a psychedelic phenethylamine with structural similarities to methallylescaline. Little information exists on the human pharmacology of 3C-MAL and it has little-to-no history of human use. The hydrochloride salt is a white crystal with a melting point of {{convert|159–160|C|F}}.{{cite journal |doi=10.1002/1522-2675(200209)85:9<3019::AID-HLCA3019>3.0.CO;2-4|year=2002| vauthors = Trachsel D |journal=Helvetica Chimica Acta|volume=85|issue=9|pages=3019–3026|title=Synthesis of novel (phenylalkyl)amines for the investigation of structure-activity relationships. Part 1. Mescalin derivatives.}}