2C-T-3
{{chembox
| ImageFile = 2C-T-3.svg
| PIN = 2-
|Section1={{Chembox Identifiers
| InChI = 1S/C14H21NO2S/c1-10(2)9-18-14-8-12(16-3)11(5-6-15)7-13(14)17-4/h7-8H,1,5-6,9,15H2,2-4H3
| InChIKey = JCDUUDQZKIXJJP-UHFFFAOYSA-N
| CASNo = 648957-40-8
| PubChem = 12063255
| ChemSpiderID = 129332310
| ChEMBL =
| SMILES = CC(=C)CSC1=C(C=C(C(=C1)OC)CCN)OC
}}
|Section2={{Chembox Properties
| Formula =
| C=14 | H=21 | N=1 | O=2 | S=1
| Appearance =
| Density =
| MeltingPtC =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
2C-T-3, also initially numbered as 2C-T-20 and also known as 4-methallylthio-2,5-dimethoxyphenethylamine, is a lesser-known psychedelic drug related to compounds such as 2C-T-7 and 2C-T-16. It was named by Alexander Shulgin but was never made or tested by him, and was instead first synthesised by Daniel Trachsel some years later. It has a binding affinity of 11nM at 5-HT2A and 40nM at 5-HT2C. It is reportedly a potent psychedelic drug with an active dose in the 15–40 mg range, and a duration of action of 8–14 hours, with visual effects comparable to related drugs such as methallylescaline.{{cite journal | vauthors = Trachsel D |year=2003 |title=Synthesis of novel (phenylalkyl)amines for the investigation of structure-activity relationships. Part 2. 4-Thio-substituted [2-(2,5-dimethoxyphenyl)ethyl]amines (=2,5-dimethoxybenzeneethanamines) |journal=Helvetica Chimica Acta |volume=86 |issue=7 |pages=2610–2619 |doi=10.1002/hlca.200390210}}{{cite journal | vauthors = Luethi D, Trachsel D, Hoener MC, Liechti ME | title = Monoamine receptor interaction profiles of 4-thio-substituted phenethylamines (2C-T drugs) | journal = Neuropharmacology | volume = 134 | issue = Pt A | pages = 141–148 | date = May 2018 | pmid = 28720478 | doi = 10.1016/j.neuropharm.2017.07.012 | s2cid = 7135811 | url = https://edoc.unibas.ch/57358/1/20170920150712_59c2680084ec5.pdf }}{{cite book | vauthors = Trachsel D, Lehmann D, Enzensperger C |name-list-style=amp |year=2013 |title=Phenethylamine: Von der Struktur zur Funktion | pages=788–794 |publisher=Nachtschatten Verlag AG |isbn=978-3-03788-700-4}}
See also
References
{{Reflist}}
{{Psychedelics}}
{{Phenethylamines}}
Category:Psychedelic phenethylamines
{{psychoactive-stub}}