4'-Fluoro-α-pyrrolidinooctanophenone

{{Short description|Stimulant drug of the cathinone class}}

{{drugbox

| IUPAC_name = 1-(4-Fluorophenyl)-2-(pyrrolidin-1-yl)octan-1-one

| image = FPOP.svg

| width = 200px

| CAS_number = 1829588-09-1

| CAS_number_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5K4EOQ3QZD

| ATC_prefix =

| ATC_suffix =

| PubChem = 121262705

| DrugBank =

| C=18 | H=26 | F=1 | N=1 | O=1

| molecular_weight =

| smiles = FC1=CC=C(C=C1)C(C(CCCCCC)N2CCCC2)=O

| ChemSpiderID = 58858887

| StdInChI = 1S/C18H26FNO/c1-2-3-4-5-8-17(20-13-6-7-14-20)18(21)15-9-11-16(19)12-10-15/h9-12,17H,2-8,13-14H2,1H3

| StdInChIKey = MNXIGHJMEAJIEV-UHFFFAOYSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA = Schedule I

| legal_DE = NpSG

| legal_UK = Class B

| legal_US =

| routes_of_administration =

}}

4'-Fluoro-α-pyrrolidinooctanophenone (also known as 4-Fluoro-PV-9, FPOP and 4-Fluoro-α-POP) is a stimulant drug of the cathinone class which has been reported as a novel designer drug.{{cite web | url=https://www.caymanchem.com/Product.vm/catalog/15063 | title= 4-Fluoro-PV-9 | publisher=Cayman Chemical}}{{cite journal | vauthors = Majchrzak M, Rojkiewicz M, Celiński R, Kuś P, Sajewicz M | title = Identification and characterization of new designer drug 4-fluoro-PV9 and α-PHP in the seized materials | journal = Forensic Toxicology | volume = 34 | issue = 1 | pages = 115–124 | date = January 2016 | pmid = 26793278 | pmc = 4705138 | doi = 10.1007/s11419-015-0295-4 }}