4F-PHP
{{Short description|Chemical compound}}
{{drugbox
| drug_name = 4-Fluoro-alpha-PHP
| image = 4F-PHP.svg
| legal_DE =
| legal_UK =
| legal_US = Unscheduled, illegal in Virginia{{cite web |title=§ 54.1-3446. Schedule I. |url=https://law.lis.virginia.gov/vacode/title54.1/chapter34/section54.1-3446/ |website=Virginia Law |access-date=15 September 2023}}
| C = 16 | H = 22 | F = 1 | N = 1 | O = 1
| IUPAC_name = 1-(4-fluorophenyl)-2-(pyrrolidin-1-yl)hexan-1-one
| CAS_number = 2230706-09-7
| ChemSpiderID =
| PubChem = 132989300
| smiles = CCCCC(C(=O)C1=CC=C(C=C1)F)N2CCCC2
| StdInChI = 1S/C16H22FNO/c1-2-3-6-15(18-11-4-5-12-18)16(19)13-7-9-14(17)10-8-13/h7-10,15H,2-6,11-12H2,1H3
| StdInChIKey = BCJXLSGKMNRRKO-UHFFFAOYSA-N
}}
4-Fluoro-alpha-PHP (4F-PHP) is a recreational designer drug from the substituted cathinone family with stimulant effects, which first appeared on the illicit market in around 2017.{{cite journal | vauthors = Liu C, Jia W, Li T, Hua Z, Qian Z | title = Identification and analytical characterization of nine synthetic cathinone derivatives N-ethylhexedrone, 4-Cl-pentedrone, 4-Cl-α-EAPP, propylone, N-ethylnorpentylone, 6-MeO-bk-MDMA, α-PiHP, 4-Cl-α-PHP, and 4-F-α-PHP | journal = Drug Testing and Analysis | volume = 9 | issue = 8 | pages = 1162–1171 | date = August 2017 | pmid = 27863142 | doi = 10.1002/dta.2136 }}{{cite journal | vauthors = Apirakkan O, Frinculescu A, Shine T, Parkin MC, Cilibrizzi A, Frascione N, Abbate V | title = Analytical characterization of three cathinone derivatives, 4-MPD, 4F-PHP and bk-EPDP, purchased as bulk powder from online vendors | journal = Drug Testing and Analysis | volume = 10 | issue = 2 | pages = 372–378 | date = February 2018 | pmid = 28544816 | doi = 10.1002/dta.2218 | s2cid = 3542312 | url = https://kclpure.kcl.ac.uk/portal/en/publications/analytical-characterization-of-three-cathinone-derivatives-4mpd-4-fphp-and-bkepdp-purchased-as-bulk-powder-from-online-vendors(c330ebc7-5c4e-434a-bf06-795fcbd68c09).html }}{{cite journal | vauthors = Eshleman AJ, Nagarajan S, Wolfrum KM, Reed JF, Swanson TL, Nilsen A, Janowsky A | title = Structure-activity relationships of bath salt components: substituted cathinones and benzofurans at biogenic amine transporters | journal = Psychopharmacology | volume = 236 | issue = 3 | pages = 939–952 | date = March 2019 | pmid = 30397775 | doi = 10.1007/s00213-018-5059-5 | pmc = 6500773 }} This compound is structurally related to other well-known stimulants and has garnered attention for its potential to mimic the effects of traditional amphetamines, leading users to seek it out for its energizing and euphoric properties.