4F-PHP

{{Short description|Chemical compound}}

{{drugbox

| drug_name = 4-Fluoro-alpha-PHP

| image = 4F-PHP.svg

| legal_DE =

| legal_UK =

| legal_US = Unscheduled, illegal in Virginia{{cite web |title=§ 54.1-3446. Schedule I. |url=https://law.lis.virginia.gov/vacode/title54.1/chapter34/section54.1-3446/ |website=Virginia Law |access-date=15 September 2023}}

| C = 16 | H = 22 | F = 1 | N = 1 | O = 1

| IUPAC_name = 1-(4-fluorophenyl)-2-(pyrrolidin-1-yl)hexan-1-one

| CAS_number = 2230706-09-7

| ChemSpiderID =

| PubChem = 132989300

| smiles = CCCCC(C(=O)C1=CC=C(C=C1)F)N2CCCC2

| StdInChI = 1S/C16H22FNO/c1-2-3-6-15(18-11-4-5-12-18)16(19)13-7-9-14(17)10-8-13/h7-10,15H,2-6,11-12H2,1H3

| StdInChIKey = BCJXLSGKMNRRKO-UHFFFAOYSA-N

}}

4-Fluoro-alpha-PHP (4F-PHP) is a recreational designer drug from the substituted cathinone family with stimulant effects, which first appeared on the illicit market in around 2017.{{cite journal | vauthors = Liu C, Jia W, Li T, Hua Z, Qian Z | title = Identification and analytical characterization of nine synthetic cathinone derivatives N-ethylhexedrone, 4-Cl-pentedrone, 4-Cl-α-EAPP, propylone, N-ethylnorpentylone, 6-MeO-bk-MDMA, α-PiHP, 4-Cl-α-PHP, and 4-F-α-PHP | journal = Drug Testing and Analysis | volume = 9 | issue = 8 | pages = 1162–1171 | date = August 2017 | pmid = 27863142 | doi = 10.1002/dta.2136 }}{{cite journal | vauthors = Apirakkan O, Frinculescu A, Shine T, Parkin MC, Cilibrizzi A, Frascione N, Abbate V | title = Analytical characterization of three cathinone derivatives, 4-MPD, 4F-PHP and bk-EPDP, purchased as bulk powder from online vendors | journal = Drug Testing and Analysis | volume = 10 | issue = 2 | pages = 372–378 | date = February 2018 | pmid = 28544816 | doi = 10.1002/dta.2218 | s2cid = 3542312 | url = https://kclpure.kcl.ac.uk/portal/en/publications/analytical-characterization-of-three-cathinone-derivatives-4mpd-4-fphp-and-bkepdp-purchased-as-bulk-powder-from-online-vendors(c330ebc7-5c4e-434a-bf06-795fcbd68c09).html }}{{cite journal | vauthors = Eshleman AJ, Nagarajan S, Wolfrum KM, Reed JF, Swanson TL, Nilsen A, Janowsky A | title = Structure-activity relationships of bath salt components: substituted cathinones and benzofurans at biogenic amine transporters | journal = Psychopharmacology | volume = 236 | issue = 3 | pages = 939–952 | date = March 2019 | pmid = 30397775 | doi = 10.1007/s00213-018-5059-5 | pmc = 6500773 }} This compound is structurally related to other well-known stimulants and has garnered attention for its potential to mimic the effects of traditional amphetamines, leading users to seek it out for its energizing and euphoric properties.

See also

References

{{reflist}}

{{Stimulants}}

Category:Pyrrolidinophenones

Category:Designer drugs

Category:4-Fluorophenyl compounds

{{nervous-system-drug-stub}}