4'-Fluorocannabidiol

{{Drugbox

| IUPAC_name = 4-Fluoro-2-[(1R,6R)-3-methyl-6-(prop-1-en-2-yl)cyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol

| image = HUF-101.svg

| image_class = skin-invert-image

| legal_AU =

| legal_CA = Schedule II

| legal_DE =

| legal_UK =

| legal_US =

| legal_status =

| IUPHAR_ligand =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 1619228-89-5

| ATC_prefix =

| ATC_suffix =

| PubChem = 76285390

| DrugBank =

| ChemSpiderID = 58191436

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8LVY7H2WCK

| C=21 | H=29 | F=1 | O=2

| molecular_weight =

| smiles = CCCCCC1=CC(=C(C(=C1F)O)[C@@H]2C=C(CC[C@H]2C(=C)C)C)O

| StdInChI = 1S/C21H29FO2/c1-5-6-7-8-15-12-18(23)19(21(24)20(15)22)17-11-14(4)9-10-16(17)13(2)3/h11-12,16-17,23-24H,2,5-10H2,1,3-4H3/t16-,17+/m0/s1

| StdInChIKey = OGZHPYIVJQZXQS-DLBZAZTESA-N

}}

4'-Fluorocannabidiol (also known as PECS-101 and 4'-F-CBD, and formerly as HUF-101 and HU-474{{cite journal | vauthors = Stollenwerk TM, Pollock S, Hillard CJ | title = Contribution of the Adenosine 2A Receptor to Behavioral Effects of Tetrahydrocannabinol, Cannabidiol and PECS-101 | journal = Molecules | volume = 26 | issue = 17 | pages = 5354 | date = 2 September 2021 | pmid = 34500787| pmc = 8434367| doi = 10.3390/molecules26175354 | bibcode = | doi-access = free }}) is a fluorinated cannabidiol derivative that has more potent anxiolytic, antidepressant, antipsychotic and anti-compulsive activity in mice compared to its parent compound.{{cite journal | vauthors = Breuer A, Haj CG, Fogaça MV, Gomes FV, Silva NR, Pedrazzi JF, Del Bel EA, Hallak JC, Crippa JA, Zuardi AW, Mechoulam R, Guimarães FS | display-authors = 6 | title = Fluorinated Cannabidiol Derivatives: Enhancement of Activity in Mice Models Predictive of Anxiolytic, Antidepressant and Antipsychotic Effects | journal = PLOS ONE | volume = 11 | issue = 7 | pages = e0158779 | date = 14 July 2016 | pmid = 27416026 | pmc = 4945002 | doi = 10.1371/journal.pone.0158779 | bibcode = 2016PLoSO..1158779B | doi-access = free }}{{cite journal | vauthors = Morales P, Reggio PH, Jagerovic N | title = An Overview on Medicinal Chemistry of Synthetic and Natural Derivatives of Cannabidiol | journal = Frontiers in Pharmacology | year = 2017 | volume = 8 | pages = 422 | pmid = 28701957 | doi = 10.3389/fphar.2017.00422 | pmc = 5487438 | doi-access = free }}{{cite journal | vauthors = Silva NR, Gomes FV, Fonseca MD, Mechoulam R, Breuer A, Cunha TM, Guimarães FS | title = Antinociceptive effects of HUF-101, a fluorinated cannabidiol derivative | journal = Progress in Neuro-Psychopharmacology & Biological Psychiatry | volume = 79 | issue = Pt B | pages = 369–377 | date = October 2017 | pmid = 28720466 | doi = 10.1016/j.pnpbp.2017.07.012 | s2cid = 21626587 }}{{cite journal | vauthors = Perez M, Cartarozzi LP, Chiarotto GB, Oliveira SA, Guimarães FS, Oliveira AL | title = Neuronal preservation and reactive gliosis attenuation following neonatal sciatic nerve axotomy by a fluorinated cannabidiol derivative | journal = Neuropharmacology | volume = 140 | pages = 201–208 | date = September 2018 | pmid = 30096328 | doi = 10.1016/j.neuropharm.2018.08.009 | s2cid = 51956774 }} It was first synthesized in 2016, alongside 10-fluorocannabidiol diacetate and 8,9-dihydro-7-fluorocannabidiol, which showed much weaker activity.