4-AcO-DPT

{{Chembox

| ImageFile = 4-AcO-DPT Structure.svg

| ImageSize = 200px

| ImageFile2 = 4-AcO-DPT.png

| ImageSize2 = 200px

| PIN = 3-[2-(Diethylamino)ethyl]-1H-indol-4-yl acetate

| OtherNames = Depracetin

|Section1={{Chembox Identifiers

| CASNo = 1445751-75-6

| PubChem = 73553809

| UNII = 1L0R752595

| ChemSpiderID = 30647009

| SMILES = CCCN(CCC)CCC1=CNC2=C1C(=CC=C2)OC(=O)C

| InChI = 1S/C18H26N2O2/c1-4-10-20(11-5-2)12-9-15-13-19-16-7-6-8-17(18(15)16)22-14(3)21/h6-8,13,19H,4-5,9-12H2,1-3H3

| InChIKey = KRUGABVNKKKCJN-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=18 | H=26 | N=2 | O=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

{{Context|date=March 2021}}

4-Acetyloxy-N,N-dipropyltryptamine (or 4-AcO-DPT) is a tryptamine derivative. 4-AcO-DPT has been sold as a designer drug.{{cite book |last1=Schifano |first1=Fabrizio |last2=Orsolini |first2=Laura |last3=Papanti |first3=Duccio |last4=Corkery |first4=John |title=Neuropharmacology of new psychoactive substances (NPS) : the science behind the headlines |series=Current Topics in Behavioral Neurosciences |year=2017 |volume=32 |publisher=Springer |location=Cham, Switzerland |isbn=978-3-319-52444-3 |pages=351–380 |doi=10.1007/978-3-319-52444-3 |s2cid=23812562 |url=https://link.springer.com/book/10.1007/978-3-319-52444-3 |access-date=14 January 2021}} It is an ester of 4-HO-DPT, a psychedelic tryptamine first synthesized by Alexander Shulgin. Anecdotal reports indicate that 4-AcO-DPT exerts psychoactive effects in humans, however, the pharmacology of 4-AcO-DPT has not been examined.{{cite web |last1=Nervewing |title=Greater Mind Lesser Body |url=https://erowid.org/experiences/exp.php?ID=112158 |website=Erowid Experience Vaults |publisher=Erowid |access-date=14 January 2021}}{{cite web | title = Tihkal 4-HO-DIPT entry| url = https://www.erowid.org/library/books_online/tihkal/tihkal17.shtml }}