4-HO-DPT

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477221941

| IUPAC_name = 3-[2-(Dipropylamino)ethyl]-1H-indol-4-ol

| image = 4-HO-DPT.svg

| image2 = 4-OH-DPT 3D BS.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_DE = NpSG

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 63065-88-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = KS597YAU98

| ATC_prefix =

| ATC_suffix =

| PubChem = 21854223

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 10579817

| chemical_formula =

| C=16 | H=24 | N=2 | O=1

| molecular_weight =

| smiles = CCCN(CCC)CCc2c[nH]c1cccc(O)c12

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H24N2O/c1-3-9-18(10-4-2)11-8-13-12-17-14-6-5-7-15(19)16(13)14/h5-7,12,17,19H,3-4,8-11H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = MZLRMPTVOVJXLW-UHFFFAOYSA-N

}}

4-HO-DPT (4-hydroxy-N,N-dipropyltryptamine, Deprocin) is a substituted tryptamine with psychedelic effects. It is the 4-hydroxyl analog of dipropyltryptamine (DPT).

In 2019, Chadeayne et al. solved the crystal structure of the fumarate salt of 4-HO-DPT.{{Cite journal| vauthors = Chadeayne AR, Pham DN, Golen JA, Manke DR |date=2019-11-28|title=Bis(4-hydroxy- N , N -di- n -propyltryptammonium) fumarate tetrahydrate|url=http://scripts.iucr.org/cgi-bin/paper?S241431461901469X|journal=IUCrData|volume=4|issue=11|pages=x191469|doi=10.1107/S241431461901469X|issn=2414-3146|doi-access=free}} The authors describe the structure as follows: "The asymmetric unit contains one 4-HO-DPT cation, protonated at the dipropylamine N atom. There are also two independent water molecules, and half of a fumarate ion present."