5-BPDi
{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Drugbox
| IUPAC_name = 1-(2,3-dihydro-1H-inden-5-yl)-2-pyrrolidin-1-ylhexan-1-one
| image = 5-HPDI_structure.png
| width = 200px
| tradename =
| routes_of_administration =
| legal_UK = Class B
| legal_DE = Anlage II
| CAS_number = 2748304-64-3
| UNII_Ref =
| UNII = AJE4Z9D96B
| PubChem = 132989236
| ChemSpiderID =
| C=19 | H=27 | N=1 | O=1
| StdInChI = 1S/C19H27NO/c1-2-3-9-18(20-12-4-5-13-20)19(21)17-11-10-15-7-6-8-16(15)14-17/h10-11,14,18H,2-9,12-13H2,1H3
| StdInChIKey = WETQQOQCDBNIKE-UHFFFAOYSA-N
| SMILES = CCCCC(C(=O)C1=CC2=C(CCC2)C=C1)N3CCCC3
}}
5-BPDi (Indanyl-α-PHP) is a substituted cathinone derivative with stimulant effects which has been sold as a designer drug, first reported in 2015.{{cite journal | vauthors = Błażewicz A, Bednarek E, Popławska M, Olech N, Sitkowski J, Kozerski L | title = Identification and structural characterization of synthetic cathinones: N-propylcathinone, 2,4-dimethylmethcathinone, 2,4-dimethylethcathinone, 2,4-dimethyl-α-pyrrolidinopropiophenone, 4-bromo-α-pyrrolidinopropiophenone, 1-(2,3-dihydro-1H-inden-5-yl)-2-(pyrrolidin-1-yl)hexan-1-one and 2,4-dimethylisocathinone. | journal = Forensic Toxicology | date = July 2019 | volume = 37 | issue = 2 | pages = 288–307 | doi = 10.1007/s11419-018-00463-w | doi-access = free }}{{cite journal | vauthors = Pulver B, Riedel J, Westphal F, Luhn S, Schönberger T, Schäper J, Auwärter V, Luf A, Pütz M | title = A new synthetic cathinone: 3,4-EtPV or 3,4-Pr-PipVP? An unsuccessful attempt to circumvent the German legislation on new psychoactive substances | journal = Drug Testing and Analysis | volume = 15 | issue = 1 | pages = 84–96 | date = January 2023 | pmid = 36136085 | doi = 10.1002/dta.3371 | doi-access = free }}