5-MBPB

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| verifiedrevid =

| IUPAC_name = 1-(1-benzofuran-5-yl)-N-methylbutan-2-amine

| image = 5-MBPB_structure.png

| width =

| tradename =

| pregnancy_category =

| legal_CA = Schedule I

| legal_DE = NpSG

| legal_UK = Class B

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number =

| ATC_prefix = none

| ATC_suffix =

| PubChem = 139033209

| ChemSpiderID = 52085237

| UNII = YHB7YWS4WJ

| C=13 | H=17 | N=1 | O=1

| molecular_weight = 203.28 g/mol (freebase) 239.78 g/mol (hydrochloride)

| smiles = CCC(CC1=CC2=C(OC=C2)C=C1)NC

| StdInChI = 1S/C13H17NO/c1-3-12(14-2)9-10-4-5-13-11(8-10)6-7-15-13/h4-8,12,14H,3,9H2,1-2H3

| StdInChIKey = CTEZPBCLIKEASW-UHFFFAOYSA-N

}}

5-MBPB (also known as 5-MPBP and 5-MABB) is an amphetamine and phenylisobutylamine derivative which is structurally related to MDMA and has been sold as a designer drug. It can be described as the benzofuran-5-yl analogue of MBDB or the butanamine homologue of 5-MAPB, and is also a structural isomer of 5-EAPB and 6-EAPB. Anecdotal reports suggest this compound has been sold as a designer drug in various European countries since early 2015, but the first definitive identification was made in December 2015 by a forensic laboratory in Slovenia.[http://www.emcdda.europa.eu/system/files/publications/2880/TDAS16001ENN.pdf European Monitoring Center for Drugs and Drug Addiction – Europol 2015 Annual Report on the implementation of Council Decision 2005/387/JHA]

5-MBPB is similar in structure to compounds such as 5-APB which are claimed to be agonists of the 5-HT_2C receptor.{{cite patent | country = US | number = 7045545 | status = patent | title = Aminoalkylbenzofurans as serotonin (5-HT(2c)) agonists | pubdate = 2000-01-19 | gdate = 2006-16-03 | inventor = Karin Briner et al }}

5-MBPB (5-MABB) has been found to act as a potent serotonin–norepinephrine–dopamine releasing agent (SNDRA), with preference for induction of serotonin release over norepinephrine and dopamine release, and fully substitutes for MDMA in animal drug discrimination tests.{{cite journal | vauthors = Johnson CB, Walther D, Baggott MJ, Baker LE, Baumann MH | title = Novel Benzofuran Derivatives Induce Monoamine Release and Substitute for the Discriminative Stimulus Effects of 3,4-Methylenedioxymethamphetamine | journal = J Pharmacol Exp Ther | volume = 391 | issue = 1 | pages = 22–29 | date = September 2024 | pmid = 38272669 | pmc = 11413916 | doi = 10.1124/jpet.123.001837 | url = }}