5-MeO-DBT

{{Short description|Chemical compound}}

{{drugbox

| drug_name = 5-MeO-DBT

| image = 5-MeO-DBT.svg

| image2 = 5-MeO-DBT 3D BS.png

| legal_UK =

| legal_DE =

| C = 19 | H = 30 | N = 2 | O = 1

| IUPAC_name = N-Butyl-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]butan-1-amine

| CAS_number = 73785-42-9

| ChemSpiderID = 30798625

| PubChem = 53485365

| UNII = Q454YC4LIK

| synonyms = 5-methoxy DBT; N,N-Dibutyl-5-methoxy-1H-indole-3-ethanamine

| smiles = CCCCN(CCCC)CCC1=CNC2=C1C=C(C=C2)OC

| StdInChI = 1S/C19H30N2O/c1-4-6-11-21(12-7-5-2)13-10-16-15-20-19-9-8-17(22-3)14-18(16)19/h8-9,14-15,20H,4-7,10-13H2,1-3H3

| StdInChIKey = WVGCRISHWANOTO-UHFFFAOYSA-N

}}

5-MeO-DBT (5-Methoxy-N,N-dibutyltryptamine, 5-MeO-BET) is a rare substituted tryptamine derivative, which is thought to be a psychoactive substance and was identified in a designer drug sample by a forensic laboratory in Slovenia in March 2021,{{cite web | url = https://www.policija.si/apps/nfl_response_web/0_Analytical_Reports_final/5-MeO-DBT-ID-2212-20_report.pdf | title = Analytical Report. 5-MeO-DBT | publisher = Nacionalni Forenzični Laboratorij | location = Slovenia | date = 10 March 2021 }} although only analytical studies have been conducted and no pharmacological data is available.{{cite journal | vauthors = Brandt SD, Freeman S, Fleet IA, McGagh P, Alder JF | title = Analytical chemistry of synthetic routes to psychoactive tryptamines. Part II. Characterisation of the Speeter and Anthony synthetic route to N,N-dialkylated tryptamines using GC-EI-ITMS, ESI-TQ-MS-MS and NMR. | journal = Analyst | date = 2005 | volume = 130 | issue = 3 | pages = 330–344 | doi = 10.1039/b413014f| pmid = 15724162 | bibcode = 2005Ana...130..330B }}{{cite journal | vauthors = Brandt SD, Freeman S, Fleet IA, Alder JF | title = Analytical chemistry of synthetic routes to psychoactive tryptamines. Part III. Characterisation of the Speeter and Anthony route to N,N-dialkylated tryptamines using CI-IT-MS-MS. | journal = Analyst | date = 2005 | volume = 130 | issue = 9 | pages = 1258–1262 | doi = 10.1039/b504001a | pmid = 16096671 | bibcode = 2005Ana...130.1258B }}{{cite journal | vauthors = Brandt SD, Martins CP | title = Analytical methods for psychoactive N,N-dialkylated tryptamines. | journal = Trends Anal. Chem. | date = 2010 | volume = 29 | issue = 8 | pages = 858–869 | doi = 10.1016/j.trac.2010.04.008 }} It is nevertheless controlled under drug analogue legislation in a number of jurisdictions.