5-MeO-T-NBOMe

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 2-(5-methoxy-1H-indol-3-yl)-N-[(2-methoxyphenyl)methyl]ethanamine

| image = 5MT-NBOMe_structure.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_status =

| legal_DE =

| legal_UK =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 1335331-37-7

| UNII =

| ATC_prefix =

| ATC_suffix =

| PubChem = 122363719

| ChemSpiderID = 26599679

| C=19 | H=22 | N=2 | O=2

| melting_point =

| smiles = COC1=CC2=C(C=C1)NC=C2CCNCC3=CC=CC=C3OC

| StdInChI = 1S/C19H22N2O2/c1-22-16-7-8-18-17(11-16)14(13-21-18)9-10-20-12-15-5-3-4-6-19(15)23-2/h3-8,11,13,20-21H,9-10,12H2,1-2H3

| StdInChIKey = OROYLKZKNDLGIQ-UHFFFAOYSA-N

}}

5-MeO-T-NBOMe (5MT-NBOMe, NBOMe-5-MeO-T) is a psychedelic of the tryptamine class that has been sold online as a designer drug. It is many times less potent than comparable phenethylamines such as 25C-NBOMe, but is still a reasonably potent and effective partial agonist for the 5-HT₂ family of serotonin receptors.{{cite journal | vauthors = Nichols DE, Sassano MF, Halberstadt AL, Klein LM, Brandt SD, Elliott SP, Fiedler WJ | title = N-Benzyl-5-methoxytryptamines as Potent Serotonin 5-HT2 Receptor Family Agonists and Comparison with a Series of Phenethylamine Analogues | journal = ACS Chemical Neuroscience | volume = 6 | issue = 7 | pages = 1165–1175 | date = July 2015 | doi = 10.1021/cn500292d | pmid = 25547199 | pmc = 4505863 }}{{cite journal | vauthors = Toro-Sazo M, Brea J, Loza MI, Cimadevila M, Cassels BK | title = 5-HT2 receptor binding, functional activity and selectivity in N-benzyltryptamines | journal = PLOS ONE | date = 2019 | volume = 14 | issue = 1 | pages = e0209804 | doi = 10.1371/journal.pone.0209804 | pmid = 30629611 | pmc = 6328172 | bibcode = 2019PLoSO..1409804T | doi-access = free }}