5F-ADBICA

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = N-[(2S)-1-Amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(5-fluoropentyl)indole-3-carboxamide

| image = 5F-ADBICA_structure.png

| image_class = skin-invert-image

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA = Schedule II

| legal_DE = NpSG

| legal_UK = Class B

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 1801338-27-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = U9H280G9O7

| ATC_prefix =

| ATC_suffix =

| PubChem = 118796421

| ChemSpiderID = 52085200

| C=20 | H=28 | N=3 | O=2 | F=1

| smiles = CC(C)(C)[C@@H](C(=O)N)NC(=O)C1=CN(C2=CC=CC=C21)CCCCCF

| StdInChI = 1S/C20H28FN3O2/c1-20(2,3)17(18(22)25)23-19(26)15-13-24(12-8-4-7-11-21)16-10-6-5-9-14(15)16/h5-6,9-10,13,17H,4,7-8,11-12H2,1-3H3,(H2,22,25)(H,23,26)/t17-/m1/s1

| StdInChIKey = ITZSOCZDFSHNCL-QGZVFWFLSA-N

}}

5F-ADBICA (also known as 5F-ADB-PICA) is an indole-based synthetic cannabinoid that is a potent agonist at CB₁ receptors and CB₂ receptors with EC₅₀ values of 0.77 nM and 1.2 nM respectively.{{cite journal | vauthors = Banister SD, Moir M, Stuart J, Kevin RC, Wood KE, Longworth M, Wilkinson SM, Beinat C, Buchanan AS, Glass M, Connor M, McGregor IS, Kassiou M | display-authors = 6 | title = Pharmacology of Indole and Indazole Synthetic Cannabinoid Designer Drugs AB-FUBINACA, ADB-FUBINACA, AB-PINACA, ADB-PINACA, 5F-AB-PINACA, 5F-ADB-PINACA, ADBICA, and 5F-ADBICA | journal = ACS Chemical Neuroscience | volume = 6 | issue = 9 | pages = 1546–59 | date = September 2015 | pmid = 26134475 | doi = 10.1021/acschemneuro.5b00112 }}{{cite web | url=http://forendex.safs1966.org/index.php/detail/index/1262 | title=5F-ADBICA | publisher=Southern Association of Forensic Scientists | access-date=21 July 2015}}