6-MAPDB
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = 1-(2,3-dihydro-1-benzofuran-6-yl)-N-methylpropan-2-amine
| image = 6-MAPDB_structure.png
| width = 240
| legal_AU =
| legal_CA = Schedule I
| legal_DE = NpSG
| legal_UK = Class B
| legal_US =
| legal_status =
| dependency_liability =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 1354631-81-4
| CAS_supplemental =
| ATCvet =
| PubChem = 112500534
| PubChemSubstance =
| IUPHAR_ligand =
| DrugBank =
| ChemSpiderID = 32078889
| UNII = 1C25E596YG
| KEGG =
| ChEBI =
| ChEMBL =
| synonyms =
| C=12 | H=17 | N=1 | O=1
| molecular_weight =
| smiles = CC(CC1=CC2=C(CCO2)C=C1)NC
| StdInChI = 1S/C12H17NO/c1-9(13-2)7-10-3-4-11-5-6-14-12(11)8-10/h3-4,8-9,13H,5-7H2,1-2H3
| StdInChIKey = ZKMVEORLSJXOBD-UHFFFAOYSA-N
| density =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| specific_rotation =
| sec_combustion =
}}
6-MAPDB (1-(2,3-dihydrobenzofuran-6-yl)-N-methylpropan-2-amine) is a chemical compound which might be an entactogenic drug. It is structurally related to drugs like 6-APDB and 6-MAPB, which have similar effects to MDMA and have been used as recreational drugs. 6-MAPDB has never been studied to determine its pharmacological activity, though it is the N-methyl derivative of 6-APDB which is known to be a selective serotonin releaser.{{cite journal | vauthors = Monte AP, Marona-Lewicka D, Cozzi NV, Nichols DE | title = Synthesis and pharmacological examination of benzofuran, indan, and tetralin analogues of 3,4-(methylenedioxy)amphetamine | journal = Journal of Medicinal Chemistry | volume = 36 | issue = 23 | pages = 3700–6 |date=November 1993 | pmid = 8246240 | doi = 10.1021/jm00075a027}}
Legality
6-MAPDB was banned in the UK in June 2013 as a temporary class drug along with 9 other related compounds, despite having never been sold as a street drug itself. This was due to concerns that it would have similar effects to drugs such as 6-APB that had been widely sold already, and 6-MAPDB might therefore be likely to become used recreationally also, if it were not banned preemptively.{{cite web | url = https://www.gov.uk/government/publications/temporary-class-drug-order-report-on-benzofury-and-nbome-compounds | title =Temporary class drug order on benzofury and NBOMe compounds - letter from ACMD | access-date = 2013-07-11 | date = 4 Jun 2013 | publisher = UK Home Office}}
See also
References
{{Reflist}}
{{Entactogens|state=expanded}}
{{Serotonergics}}
{{Phenethylamines}}