6-MAPDB

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 1-(2,3-dihydro-1-benzofuran-6-yl)-N-methylpropan-2-amine

| image = 6-MAPDB_structure.png

| width = 240

| legal_AU =

| legal_CA = Schedule I

| legal_DE = NpSG

| legal_UK = Class B

| legal_US =

| legal_status =

| dependency_liability =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 1354631-81-4

| CAS_supplemental =

| ATCvet =

| PubChem = 112500534

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 32078889

| UNII = 1C25E596YG

| KEGG =

| ChEBI =

| ChEMBL =

| synonyms =

| C=12 | H=17 | N=1 | O=1

| molecular_weight =

| smiles = CC(CC1=CC2=C(CCO2)C=C1)NC

| StdInChI = 1S/C12H17NO/c1-9(13-2)7-10-3-4-11-5-6-14-12(11)8-10/h3-4,8-9,13H,5-7H2,1-2H3

| StdInChIKey = ZKMVEORLSJXOBD-UHFFFAOYSA-N

| density =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| specific_rotation =

| sec_combustion =

}}

6-MAPDB (1-(2,3-dihydrobenzofuran-6-yl)-N-methylpropan-2-amine) is a chemical compound which might be an entactogenic drug. It is structurally related to drugs like 6-APDB and 6-MAPB, which have similar effects to MDMA and have been used as recreational drugs. 6-MAPDB has never been studied to determine its pharmacological activity, though it is the N-methyl derivative of 6-APDB which is known to be a selective serotonin releaser.{{cite journal | vauthors = Monte AP, Marona-Lewicka D, Cozzi NV, Nichols DE | title = Synthesis and pharmacological examination of benzofuran, indan, and tetralin analogues of 3,4-(methylenedioxy)amphetamine | journal = Journal of Medicinal Chemistry | volume = 36 | issue = 23 | pages = 3700–6 |date=November 1993 | pmid = 8246240 | doi = 10.1021/jm00075a027}}

Legality

6-MAPDB was banned in the UK in June 2013 as a temporary class drug along with 9 other related compounds, despite having never been sold as a street drug itself. This was due to concerns that it would have similar effects to drugs such as 6-APB that had been widely sold already, and 6-MAPDB might therefore be likely to become used recreationally also, if it were not banned preemptively.{{cite web | url = https://www.gov.uk/government/publications/temporary-class-drug-order-report-on-benzofury-and-nbome-compounds | title =Temporary class drug order on benzofury and NBOMe compounds - letter from ACMD | access-date = 2013-07-11 | date = 4 Jun 2013 | publisher = UK Home Office}}

See also

References

{{Reflist}}

{{Entactogens|state=expanded}}

{{Serotonergics}}

{{Phenethylamines}}

Category:Methamphetamines

Category:6-Benzofuranethanamines

Category:Designer drugs

Category:Entactogens