7α-Hydroxyepiandrosterone

{{Chembox

| ImageFile = 7α-Hydroxyepiandrosterone.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = 3β,7α-Dihydroxy-5α-androstan-17-one

| SystematicName = (3aS,3bR,4R,5aR,7S,9aS,9bS,11aS)-4,7-Dihydroxy-9a,11a-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-1-one

| OtherNames = 7α-OH-EPIA; 5α-Androstan-3β,7α-diol-17-one

| Section1 = {{Chembox Identifiers

| CASNo = 25848-68-4

| CASNo_Ref = {{Cascite|changed|GSRS}}

| ChEBI = 85816

| ChEMBL = 3391767

| ChemSpiderID = 7990794

| PubChem = 9815044

| UNII = VB5FN8PDH4

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)[C@H](O)C[C@H]1C[C@@H](O)CC[C@]31C

| StdInChI = 1S/C19H30O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h11-15,17,20-21H,3-10H2,1-2H3/t11-,12+,13+,14+,15-,17+,18+,19+/m1/s1

| StdInChIKey = VFPMCLQMAUVEHD-KMQZSKAMSA-N

}}

| Section2 = {{Chembox Properties

| C=19 | H=30 | O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

7α-Hydroxyepiandrosterone (7α-OH-EPIA), also known as 3β,7α-dihydroxy-5α-androstan-17-one, is an endogenous, naturally occurring metabolite of epiandrosterone and dehydroepiandrosterone (DHEA) that is formed by the enzyme CYP7B1 in tissues such as the liver and brain.{{cite book|title=Neurosteroids and Brain Function|url=https://books.google.com/books?id=BJumUEbiaPYC&pg=PA90|date=12 December 2001|publisher=Academic Press|isbn=978-0-08-054423-6|pages=90–}}{{cite book|author=MORFIN Robert|title=Les stéroïdes naturels de A à Z|url=https://books.google.com/books?id=SZ31AQAAQBAJ&pg=PA427|date=20 December 2010|publisher=Lavoisier|isbn=978-2-7430-1918-1|pages=427–}}{{cite journal | vauthors = Hennebert O, Pernelle C, Ferroud C, Morfin R | title = 7alpha- and 7beta-hydroxy-epiandrosterone as substrates and inhibitors for the human 11beta-hydroxysteroid dehydrogenase type 1 | journal = J. Steroid Biochem. Mol. Biol. | volume = 105 | issue = 1–5 | pages = 159–65 | year = 2007 | pmid = 17624766 | doi = 10.1016/j.jsbmb.2006.11.021 | s2cid = 54408683 }}