7-PET

{{Short description|Opioid analgesic drug}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477226838

| IUPAC_name = (2R)-2-((4R,7S,7aR,12bS,14R)-7,9-dimethoxy-3-methyl-1,2,3,4,7,7a-hexahydro-7,4a-ethano-4,12-methanobenzofuro[3,2-e]isoquinolin-14-yl)-4-phenylbutan-2-ol

| image = 7-PET.svg

| image_class = skin-invert-image

| width = 150px

| tradename =

| legal_status =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 13965-63-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = EA1GYF2V3I

| PubChem = 203125

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 21106246

| C=31 | H=39 | N=1 | O=4

| smiles = O[C@](C)(CCc1ccccc1)[C@H]7CC64\C=C/[C@@]7(OC)[C@@H]5Oc2c3c(ccc2OC)C[C@H]6N(CC[C@@]345)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C31H39NO4/c1-28(33,13-12-20-8-6-5-7-9-20)23-19-29-14-15-31(23,35-4)27-30(29)16-17-32(2)24(29)18-21-10-11-22(34-3)26(36-27)25(21)30/h5-11,23-24,27,33H,12-19H2,1-4H3/t23?,24-,27?,28?,29-,30+,31-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CSZMZMPPNJFGRW-TZBHJBKBSA-N

}}

7-PET is an opioid analgesic drug that has 300 times the potency of morphine by weight.{{cite journal | vauthors = Lewis JW, Bentley KW, Cowan A | title = Narcotic analgesics and antagonists | journal = Annual Review of Pharmacology | volume = 11 | pages = 241–270 | year = 1971 | pmid = 4948499 | doi = 10.1146/annurev.pa.11.040171.001325 }} It was discovered by K.W. Bentley{{cite journal | vauthors = Bentley KW, Hardy DG, Meek B | title = Novel analgesics and molecular rearrangements in the morphine-thebaine group. II. Alcohols derived from 6,14-endo-etheno- and 6,14-endo-ethanotetrahydrothebaine | journal = Journal of the American Chemical Society | volume = 89 | issue = 13 | pages = 3273–3280 | date = June 1967 | pmid = 6042763 | doi = 10.1021/ja00989a031 }} and is related to the more well known oripavine derivative etorphine, which is used as a veterinary painkiller and anesthetic medication for the sedation of large animals such as elephants, giraffes, and rhinos. 7-PET itself has a 3-O-methyl ether which reduces potency, but the 3-OH derivative is around 2200 times more potent than morphine, almost the same potency as etorphine as a μ agonist,{{cite journal | vauthors = Feinberg AP, Creese I, Snyder SH | title = The opiate receptor: a model explaining structure-activity relationships of opiate agonists and antagonists | journal = Proceedings of the National Academy of Sciences of the United States of America | volume = 73 | issue = 11 | pages = 4215–4219 | date = November 1976 | pmid = 186791 | pmc = 431391 | doi = 10.1073/pnas.73.11.4215 | doi-access = free | bibcode = 1976PNAS...73.4215F }}{{ cite book | vauthors = Bentley KW, Lewis JW | veditors = Kosterlitz HW, Collier HO, Villarreal JE | title = Agonist and Antagonist Actions of Narcotic Analgesic Drugs | pages = 7–16 | publisher = University Park Press | location = Baltimore | year = 1973 | isbn = 978-0839107255 | lccn = 72012612 }} and unexpectedly the 3-hydrogen compound is also around the same potency of 2000 times morphine.{{cite journal | vauthors = Lewis JW, Readhead MJ | title = Novel analgetics and molecular rearrangements in the morphine-thebaine group. 18. 3-deoxy-6,14-endo-etheno-6,7,8,14-tetrahydrooripavines | journal = Journal of Medicinal Chemistry | volume = 13 | issue = 3 | pages = 525–527 | date = May 1970 | pmid = 5441135 | doi = 10.1021/jm00297a041 }}

Unlike etorphine, 7-PET is not controlled under the UN drug conventions, but it might still be considered to be a controlled substance analogue of etorphine on the grounds of its related chemical structure in some jurisdictions such as the United States, Canada, Australia, and New Zealand.