RAM-378

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 451560012

| IUPAC_name = 3,6,14-trihydroxy-4,5α-epoxy-17-(2-phenylethyl)morphinan

| image = RAM-378.svg

| image_class = skin-invert-image

| width = 220

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 4778-96-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = JD4S8J3CMK

| ATC_prefix =

| ATC_suffix =

| PubChem = 5492826

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4591168

| synonyms =

| C=24 | H=27 | N=1 | O=4

| smiles = C1C[C@]2([C@H]3CC4=C5[C@@]2(CCN3CCC6=CC=CC=C6)[C@H]([C@H]1O)OC5=C(C=C4)O)O

| StdInChI = 1S/C24H27NO4/c26-17-7-6-16-14-19-24(28)10-8-18(27)22-23(24,20(16)21(17)29-22)11-13-25(19)12-9-15-4-2-1-3-5-15/h1-7,18-19,22,26-28H,8-14H2/t18-,19+,22-,23-,24+/m0/s1

| StdInChIKey = GAHRZWMAHDWVCL-VKJMTUIMSA-N

}}

RAM-378{{cite journal | vauthors = Ben Haddou T, Béni S, Hosztafi S, Malfacini D, Calo G, Schmidhammer H, Spetea M | title = Pharmacological investigations of N-substituent variation in morphine and oxymorphone: opioid receptor binding, signaling and antinociceptive activity | journal = PLOS ONE | volume = 9 | issue = 6 | pages = e99231 | date = 2014 | pmid = 24919067 | pmc = 4053365 | doi = 10.1371/journal.pone.0099231 | bibcode = 2014PLoSO...999231B | doi-access = free }}(7,8-Dihydro-14-hydroxy-N-phenethylnormorphine) is an opioid analgesic. It is the N-phenethyl derivative of hydromorphinol.