ADB-5'F-BUTINACA

{{Short description|Chemical compound}}

{{Infobox drug

| IUPAC_name = N-(1-amino-3,3-dimethyl-1-oxo-2-butanyl)-1-butyl-1H-5-fluoroindazole-3-carboxamide

| image = ADB-5'F-BUTINACA_structure.png

| image_class = skin-invert-image

| width = 200px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_DE =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number =

| ATC_prefix =

| ATC_suffix =

| PubChem =

| ChemSpiderID =

| UNII =

| smiles = NC(=O)[C@@H](NC(=O)c1nn(CCCC)c2ccc(F)cc21)C(C)(C)C

| C=18 | H=25 | F=1 | N=4 | O=2

| StdInChI = 1S/C18H25FN4O2/c1-5-6-9-23-13-8-7-11(19)10-12(13)14(22-23)17(25)21-15(16(20)24)18(2,3)4/h7-8,10,15H,5-6,9H2,1-4H3,(H2,20,24)(H,21,25)/t15-/m1/s1

| StdInChIKey = JORGRORAECYNOJ-OAHLLOKOSA-N

}}

ADB-5'F-BUTINACA is an indazole-3-carboxamide based synthetic cannabinoid receptor agonist. It was synthesised as part of investigations into related compounds such as ADB-5'Br-BUTINACA and MDMB-5'Br-BUTINACA, and confirmed that fluorination of the indazole 5-position increases potency in a similar manner to bromination.{{cite journal | vauthors = Deventer MH, Persson M, Norman C, Liu H, Connolly MJ, Daéid NN, McKenzie C, Gréen H, Stove CP | title = In vitro cannabinoid activity profiling of generic ban-evading brominated synthetic cannabinoid receptor agonists and their analogs | journal = Drug Testing and Analysis | volume = | issue = | pages = | date = October 2023 | pmid = 37903509 | doi = 10.1002/dta.3592 | s2cid = 264671035 | url = }}