MDMB-5'Br-BUTINACA
{{Short description|Chemical compound}}
{{Infobox drug
| IUPAC_name = methyl (2S)-2-[(5-bromo-1-butylindazole-3-carbonyl)amino]-3,3-dimethylbutanoate
| image = MDMB-5'Br-BUTINACA_structure.png
| image_class = skin-invert-image
| width = 200px
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_DE =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 1185888-28-1
| ATC_prefix =
| ATC_suffix =
| PubChem = 168325141
| ChemSpiderID =
| UNII =
| smiles = CCCCN1C2=C(C=C(C=C2)Br)C(=N1)C(=O)N[C@H](C(=O)OC)C(C)(C)C
| C=19 | H=26 | Br=1 | N=3 | O=3
| StdInChI = 1S/C19H26BrN3O3/c1-6-7-10-23-14-9-8-12(20)11-13(14)15(22-23)17(24)21-16(18(25)26-5)19(2,3)4/h8-9,11,16H,6-7,10H2,1-5H3,(H,21,24)/t16-/m1/s1
| StdInChIKey = NKCFVJNTALOWGJ-MRXNPFEDSA-N
}}
MDMB-5'Br-BUTINACA (5'-Br-MDMB-BUTINACA) is an indazole-3-carboxamide based synthetic cannabinoid receptor agonist that has been sold as a designer drug. It was first identified in Russia in August 2022. It is believed to be synthesized from the "half finished" synthesis precursor MDMB-5Br-INACA, which is shipped to the destination and then the final synthetic step is completed on arrival.[https://assets.publishing.service.gov.uk/government/uploads/system/uploads/attachment_data/file/1159142/Cumyl-pegalone_and_other_uncontrolled_SCRA_report-FINAL.pdf Cumyl-PeGaClone and other recently encountered synthetic cannabinoid receptor agonists. A review of the evidence on their use and harms. Advisory Council on the Misuse of Drugs, 2022]{{cite journal | vauthors = Yurchenko L, Pavlovets Y |title=Recent trends in the identification of psychoactive substances. | date = August 2022 | language = Russian |journal=Latest Trends in the Field of Identification of Psychoactive Substances |volume=32 |doi=10.13140/RG.2.2.34906.62402 | url = https://www.researchgate.net/publication/363137423 }}{{cite journal | vauthors = Deventer MH, Persson M, Norman C, Liu H, Connolly MJ, Daéid NN, McKenzie C, Gréen H, Stove CP | title = In vitro cannabinoid activity profiling of generic ban-evading brominated synthetic cannabinoid receptor agonists and their analogs | journal = Drug Testing and Analysis | volume = | issue = | pages = | date = October 2023 | pmid = 37903509 | doi = 10.1002/dta.3592 | s2cid = 264671035 }}
See also
References
{{Reflist}}
{{Cannabinoids}}
{{Cannabinoidergics}}
{{cannabinoid-stub}}