AMPA

{{Other uses}}

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477236183

| ImageFile = AMPA.svg

| ImageSize = 200px

| ImageClass = skin-invert

| IUPACName = 2-Amino-3-(3-hydroxy-5-methyl-isoxazol-4-yl)propanoic acid

| OtherNames =

|Section1={{Chembox Identifiers

| IUPHAR_ligand = 4131

| InChIKey = UUDAMDVQRQNNHZ-UHFFFAOYAT

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 74341-63-2

| PubChem = 1221

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 276815

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB02057

| KEGG_Ref = C13672

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C7H10N2O4/c1-3-4(6(10)9-13-3)2-5(8)7(11)12/h5H,2,8H2,1H3,(H,9,10)(H,11,12)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = UUDAMDVQRQNNHZ-UHFFFAOYSA-N

| SMILES = O=C1/C(=C(\ON1)C)CC(N)C(=O)O

| InChI = 1/C7H10N2O4/c1-3-4(6(10)9-13-3)2-5(8)7(11)12/h5H,2,8H2,1H3,(H,9,10)(H,11,12)

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 1184

| MeSHName = AMPA

}}

|Section2={{Chembox Properties

| C=7 | H=10 | N=2 | O=4

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

α-Amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid, better known as AMPA, is a compound that is a specific agonist for the AMPA receptor, where it mimics the effects of the neurotransmitter glutamate.{{cite book |author=Purves, Dale |author2=George J. Augustine |author3=David Fitzpatrick |author4=William C. Hall |author5=Anthony-Samuel LaMantia |author6=James O. McNamara |author7=Leonard E. White |name-list-style=amp|title=Neuroscience|edition=4th|publisher=Sinauer Associates|pages=128–33|year=2008|isbn=978-0-87893-697-7}}

There are several types of glutamatergic ion channels in the central nervous system including AMPA, kainic acid and N-methyl-D-aspartic acid (NMDA) channels. In the synapse, these receptors serve very different purposes. AMPA can be used experimentally to distinguish the activity of one receptor from the other in order to understand their differing functions.{{cite journal|last1=Dinh|first1=L|author2=Nguyen T |author3=Salgado H |author4=Atzori M |title=Norepinephrine homogeneously inhibits alpha-amino-3-hydroxyl-5-methyl-4-isoxazole-propionate- (AMPAR-) mediated currents in all layers of the temporal cortex of the rat|journal=Neurochem Res|volume=34|issue=11|pages=1896–906|year=2009|pmid=19357950|doi=10.1007/s11064-009-9966-z|s2cid=25255160}} AMPA generates fast excitatory postsynaptic potentials (EPSP). AMPA activates AMPA receptors that are non-selective cationic channels allowing the passage of Na+ and K+ and therefore have an equilibrium potential near 0 mV.

AMPA was first synthesized, along with several other ibotenic acid derivatives, by Krogsgaard-Larsen, Honoré, and others toward differentiating glutamate sensitive receptors from aspartate sensitive receptors.{{cite journal |last1=Krogsgaard-Larsen|first1=P|author2=Honore T |author3=Hansen JJ |author4=Curtis DR|author5=Lodge D |title=New class of glutamate agonist structurally related to ibotenic acid|journal=Nature|volume=284|pages=64–66|year=1980|issue=5751|pmid=6101908|doi=10.1038/284064a0|bibcode=1980Natur.284...64K|s2cid=4252428}}

See also

References