AZD-7268
{{Short description|Abandoned antidepressant drug}}
{{Infobox drug
| drug_name =
| image = AZD-7268.svg
| width =
| caption =
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_CA =
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_category =
| dependency_liability =
| addiction_liability =
| routes_of_administration = Oral
| class = δ-Opioid receptor agonist
| ATC_prefix =
| ATC_suffix =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
| CAS_number = 1018988-00-5
| CAS_supplemental =
| PubChem = 24772484
| PubChemSubstance =
| IUPHAR_ligand = 7824
| DrugBank =
| ChemSpiderID = 28490710
| UNII = 958Y70F3HQ
| KEGG =
| ChEBI =
| ChEMBL = 1946618
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = AZD7268; AZ12488024; AZ-12488024
| IUPAC_name = N-(2-hydroxyethyl)-N-methyl-4-[quinolin-8-yl-[1-(1,3-thiazol-4-ylmethyl)piperidin-4-ylidene]methyl]benzamide
| C=29 | H=30 | N=4 | O=2 | S=1
| SMILES = CN(CCO)C(=O)C1=CC=C(C=C1)C(=C2CCN(CC2)CC3=CSC=N3)C4=CC=CC5=C4N=CC=C5
| StdInChI = 1S/C29H30N4O2S/c1-32(16-17-34)29(35)24-9-7-21(8-10-24)27(26-6-2-4-23-5-3-13-30-28(23)26)22-11-14-33(15-12-22)18-25-19-36-20-31-25/h2-10,13,19-20,34H,11-12,14-18H2,1H3
| StdInChIKey = ZJKUETLEJYCOBO-UHFFFAOYSA-N
}}
AZD-7268 is a δ-opioid receptor agonist which was under development for the treatment of major depressive disorder but was never marketed.{{cite web | title=AZD 7268 | website=AdisInsight | date=5 November 2023 | url=https://adisinsight.springer.com/drugs/800029682 | access-date=22 October 2024}}{{cite web | title=Delving into the Latest Updates on AZD-7268 with Synapse | website=Synapse | date=19 September 2024 | url=https://synapse.patsnap.com/drug/c8a1d33533454c898fe14c16b96012e5 | access-date=22 October 2024}}{{cite journal | vauthors = Mandrioli R, Mercolini L | title = Discontinued anxiolytic drugs (2009 - 2014) | journal = Expert Opin Investig Drugs | volume = 24 | issue = 4 | pages = 557–573 | date = April 2015 | pmid = 25557457 | doi = 10.1517/13543784.2014.998335 | url = }} It is taken by mouth.
The affinity (Ki) of AZD-7268 for the δ-opioid receptor was reported to be 2.7{{nbsp}}nM and its selectivity for this receptor over the μ-opioid receptor was reported to be 2,000-fold.{{cite journal | vauthors = Fujii H, Takahashi T, Nagase H | title = Non-peptidic δ opioid receptor agonists and antagonists (2000 - 2012) | journal = Expert Opin Ther Pat | volume = 23 | issue = 9 | pages = 1181–1208 | date = September 2013 | pmid = 23705966 | doi = 10.1517/13543776.2013.804066 | url = }} No animal studies of AZD-7268 appear to have been published. In addition to putative antidepressant effects, AZD-7268 might have anxiolytic effects. Structurally, AZD-7268 was derived from SNC-80.
Dose-limiting side effects of AZD-7268 in clinical trials included syncope (fainting), hypotension (low blood pressure), and dizziness.
AZD-7268 was first described by 2007. Its development was discontinued in 2010. It reached phase 2 clinical trials prior to the discontinuation of its development. No reason was given for the discontinuation of its development. However, the drug was found to be ineffective for major depressive disorder in a phase 2 clinical trial of 231{{nbsp}}participants comparing it with placebo and escitalopram.{{cite journal | vauthors = Sakurai H, Yonezawa K, Tani H, Mimura M, Bauer M, Uchida H | title = Novel Antidepressants in the Pipeline (Phase II and III): A Systematic Review of the US Clinical Trials Registry | journal = Pharmacopsychiatry | volume = 55 | issue = 4 | pages = 193–202 | date = July 2022 | pmid = 35045580 | pmc = 9259184 | doi = 10.1055/a-1714-9097 | url = }}{{cite journal | vauthors = Connolly KR, Thase ME | title = Emerging drugs for major depressive disorder | journal = Expert Opin Emerg Drugs | volume = 17 | issue = 1 | pages = 105–126 | date = March 2012 | pmid = 22339643 | doi = 10.1517/14728214.2012.660146 | url = }} The drug was under development by AstraZeneca.