Ammonium ferric citrate

{{Short description|Highly soluble organic compound, food ingredient}}

{{Use dmy dates|date=June 2023}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| ImageFile1=Ammoniumeisen(III)-citrat V7.svg

| ImageSize1=260px

| ImageCaption1 = Structure of ammonium ferric citrate

| ImageFile2=Ammonium ferric citrate dihydrate structure.png

| ImageSize2=260px

| ImageCaption2 = Crystal structure of {{chem2|[NH4]5[Fe(C6H4O7)2]*2H2O}}

| verifiedrevid = 399508653

| IUPACName = 2-Hydroxypropane-1,2,3-tricarboxylate, ammonium iron(3+) salt

| OtherNames = Ferric ammonium citrate
Ammonium iron(III) citrate
Ammonium ferric citrate
Iron ammonium citrate
FerriSeltz

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 13804

| ChEBI = 31604

| InChI = 1/C6H8O7.Fe.H3N/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;1H3/q;+3;/p-2

| InChIKey = FRHBOQMZUOWXQL-NUQVWONBAA

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C6H8O7.Fe.H3N/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;1H3/q;+3;/p-2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FRHBOQMZUOWXQL-UHFFFAOYSA-L

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 1185-57-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = UVP74NG1C5

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1200460

| EC_number = 214-686-6

| EINECS =

| PubChem = 14457

| SMILES = C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.N.[Fe+3]

| MeSHName =

| KEGG_Ref = {{cite web | url=http://www.genome.jp/dbget-bin/www_bget?drug:D01644 | title=KEGG DRUG: Ferric ammonium citrate}}

| KEGG =D01644

}}

|Section2={{Chembox Properties

| Formula = C₆H₈O₇⋅xFe³⁺⋅yNH₃

| MolarMass =

| Appearance = yellow crystals

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section7={{Chembox Hazards

| ExternalSDS = [http://www.sciencelab.com/msds.php?msdsId=9924029]

| FlashPt =

| AutoignitionPt = }}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = V08

| ATCCode_suffix = CA07

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

}}

}}

Ammonium ferric citrate (also known as ferric ammonium citrate or ammoniacal ferrous citrate) has the formula {{chem2|[NH4]y[Fe_x(C6H4O7)]}}. The iron in this compound is trivalent. All three carboxyl groups and the central hydroxyl group of citric acid are deprotonated. A distinguishing feature of this compound is that it is very soluble in water, in contrast to ferric citrate which is not very soluble.{{Cite web |last=PubChem |title=Ammonium ferric citrate |url=https://pubchem.ncbi.nlm.nih.gov/compound/3080636 |access-date=2022-10-04 |website=pubchem.ncbi.nlm.nih.gov |language=en}}

In its crystal structure each moiety of citric acid has lost four protons. The deprotonated hydroxyl group and two of the carboxylate groups ligate to the ferric center, while the third carboxylate group coordinates with the ammonium.

{{cite journal

| first1= M. | last1= Matzapetakis

| first2= C. P. | last2= Raptopoulou

| first3 =A. | last3=Tsohos

| first4 = V. | last4= Papaefthymiou

| first5 = N. | last5= Moon

| first6 = A. | last6= Salifoglou

| title= Synthesis, Spectroscopic and Structural Characterization of the First Mononuclear, Water Soluble Iron−Citrate Complex, (NH₄)₅Fe(C₆H₄O₇)₂·2H₂O

| journal= J. Am. Chem. Soc.| year = 1998| volume= 120| issue= 50| pages= 13266–13267| doi= 10.1021/ja9807035

}}