Angustific acid

{{Chembox

| Name = Angustific acids A and B

| ImageFile = Angustific Acid A and B.png

| ImageSize =

| IUPACName = A:(2Z)-6-[(1R,3S,6S,10S,11S,12R,17R)-17-Isopropenyl-6,10-dimethyl-14-oxo-13-oxapentacyclo[10.4.2.01,3.03,11.06,10]octadec-7-en-7-yl]-2-methyl-2,6-heptadienoic acid
B: (2Z,6S)-6-[(3S,3aS,3bR,4S,6S,6aR,7aS,9aS)-6a-(2-Carboxyethyl)-3,4-dihydroxy-6-isopropenyl-3a,9a-dimethyl-3a,3b,4,5,6,6a,7,8,9,9a-decahydro-3H-cyclopenta[a]cyclopropa[e]naphthalen-1-yl]-6-hydroxy-2-methyl-2-heptenoic acid

| OtherNames =

| Section1 = {{Chembox Identifiers

| index_label = A

| index1_label = B

| CASNo =

| PubChem = 53325465

| PubChem1 = 51003481

| ChEMBL = 1669428

| ChEMBL1 = 1669429

| ChemSpiderID = 26389056

| ChemSpiderID1 = 26387137

| SMILES = CC(=C)[C@H]1C[C@@H]2[C@H]3[C@@]4(CC=C([C@]4(CC[C@@]35[C@@]1(C5)CCC(=O)O2)C)C(=C)CC/C=C(/C)\C(=O)O)C

| SMILES1 = CC(=C)[C@@H]1C[C@@H]([C@H]2[C@@]3([C@H](C=C([C@]3(CC[C@@]24[C@@]1(C4)CCC(=O)O)C)[C@](C)(CC/C=C(/C)\C(=O)O)O)O)C)O

| InChI = 1S/C30H40O4/c1-18(2)22-16-23-25-28(6)12-10-21(19(3)8-7-9-20(4)26(32)33)27(28,5)14-15-30(25)17-29(22,30)13-11-24(31)34-23/h9-10,22-23,25H,1,3,7-8,11-17H2,2,4-6H3,(H,32,33)/b20-9-/t22-,23-,25+,27-,28+,29-,30+/m1/s1

| InChIKey = OEBCOPKBNAGZEV-PNVFSJBDSA-N

| InChI1 = 1S/C30H44O7/c1-17(2)19-14-20(31)24-28(6)22(32)15-21(27(5,37)10-7-8-18(3)25(35)36)26(28,4)12-13-30(24)16-29(19,30)11-9-23(33)34/h8,15,19-20,22,24,31-32,37H,1,7,9-14,16H2,2-6H3,(H,33,34)(H,35,36)/b18-8-/t19-,20-,22-,24-,26+,27-,28-,29+,30-/m0/s1

| InChIKey1 = MHUCDSJUECUYSY-OTEBZQEVSA-N

}}

| Section2 = {{Chembox Properties

| Formula = A: C30H40O4
B:C30H44O7

| MolarMass = A: 464.64 g/mol
B: 516.67 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| Autoignition =

}}

}}

Angustific acid A and angustific acid B are antiviral compounds isolated from Kadsura angustifolia.{{cite journal | last1 = Sun | first1 = R. | last2 = Song | first2 = HC. | last3 = Wang | first3 = CR. | last4 = Shen | first4 = KZ. | last5 = Xu | first5 = YB. | last6 = Gao | first6 = YX. | last7 = Chen | first7 = YG. | last8 = Dong | first8 = JY. | title = Compounds from Kadsura angustifolia with anti-HIV activity. | journal = Bioorg Med Chem Lett | volume = 21 | issue = 3 | pages = 961–5 |date=Feb 2011 | doi = 10.1016/j.bmcl.2010.12.055 | pmid = 21232955 }} They are triterpenoids.{{cite journal|last1=Xia|first1=Yong-Gang|last2=Yang|first2=Bing-You|last3=Kuang|first3=Hai-Xue|date=April 2015|title=Schisandraceae triterpenoids: a review|journal=Phytochemistry Reviews|language=en|volume=14|issue=2|pages=155–187|doi=10.1007/s11101-014-9343-7|bibcode=2015PChRv..14..155X |s2cid=6920531|issn=1568-7767}}

See also

References