Neokadsuranin

{{Chembox

| ImageFile = Neokadsuranin.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 163660-06-8

| ChEMBL = 485477

| ChemSpiderID = 20576743

| PubChem = 44575997

| SMILES = C[C@@H]1[C@@H]([C@H]2C3=CC(=C(C(=C3C4=C(C5=C(C=C4[C@@H]1O2)OCO5)OC)OC)OC)OC)C

| StdInChI=1S/C23H26O7/c1-10-11(2)19-13-8-15-21(29-9-28-15)23(27-6)17(13)16-12(18(10)30-19)7-14(24-3)20(25-4)22(16)26-5/h7-8,10-11,18-19H,9H2,1-6H3/t10-,11+,18-,19+/m0/s1

| StdInChIKey = RNIZTMIJCBCDBR-XJSVZPCESA-N

}}

|Section2={{Chembox Properties

| C=23 | H=26 | O=7

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Neokadsuranin is a chemical compound isolated from Kadsura induta that has in vitro antiviral effects.{{cite journal | doi = 10.1002/cbdv.200790087 | pmid = 17511012 | title = Dibenzocyclooctane Lignans from the Stems of Kadsura induta and Their Antiviral Effect on Hepatitis B Virus | journal = Chemistry & Biodiversity | volume = 4 | issue = 5 | pages = 966–972 | year = 2007 | last1 = Ma | first1 = Wenhui | last2 = Ma | first2 = Xiaolin | last3 = Huang | first3 = Hai | last4 = Zhou | first4 = Pei | last5 = Chen | first5 = Daofeng | s2cid = 12166640 }}