BRL-54443

{{Short description|Chemical compound}}

{{Infobox drug

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 451562796

| IUPAC_name = 3-(1-methylpiperidin-4-yl)-1H-indol-5-ol

| image = BRL-54443 Structure.svg

| width = 240

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 3927

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 57477-39-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Q2DH1CHI0Y

| ATC_prefix =

| ATC_suffix =

| PubChem = 2438

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 2344

| smiles = Oc3ccc1c(c(c[nH]1)C2CCN(C)CC2)c3

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C14H18N2O/c1-16-6-4-10(5-7-16)13-9-15-14-3-2-11(17)8-12(13)14/h2-3,8-10,15,17H,4-7H2,1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = WKNFADCGOAHBPG-UHFFFAOYSA-N

| C=14 | H=18 | N=2 | O=1

| melting_point =

| melting_high =

}}

BRL-54443 is a drug which acts as a selective agonist for the 5-HT_1E and 5-HT_1F serotonin receptor subtypes.{{cite journal |vauthors=McKune CM, Watts SW |title=Characterization of the serotonin receptor mediating contraction in the mouse thoracic aorta and signal pathway coupling |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=297 |issue=1 |pages=88–95 |date=April 2001 |pmid=11259531 }}{{cite journal |vauthors=Janssen P, Tack J, Sifrim D, Meulemans AL, Lefebvre RA |title=Influence of 5-HT1 receptor agonists on feline stomach relaxation |journal=European Journal of Pharmacology |volume=492 |issue=2–3 |pages=259–67 |date=May 2004 |pmid=15178373 |doi=10.1016/j.ejphar.2004.03.054 }}