Barium bromate

{{chembox

| verifiedrevid =

| Name = Barium bromate

| ImageFile = Barium bromate.svg

| ImageSize =

| ImageName =

| IUPACName =

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo = 13967-90-3

| CASNo_Ref =

| ChemSpiderID = 58778378

| RTECS =

| PubChem = 61706

| EINECS = 237-750-5

| UNNumber = 2719

| UNII = 5QK4064Y0R

| SMILES = [O-]Br(=O)=O.[O-]Br(=O)=O.[Ba+2]

| InChI = InChI=1S/Ba.2BrHO3/c;2*2-1(3)4/h;2*(H,2,3,4)/q+2;;/p-2

| StdInChI=1S/Ba.2BrHO3/c;2*2-1(3)4/h;2*(H,2,3,4)/q+2;;/p-2

| StdInChIKey = VEASZGAADGZARC-UHFFFAOYSA-L

}}

| Section2 = {{Chembox Properties

| Formula = Ba(BrO₃)₂ or BaBr₂O₆

| MolarMass = 393.13

| Density =

| Solubility =

| MeltingPtC =

| MeltingPt_notes =

| BoilingPt =

| pKa =

| pKb =

| Appearance = White crystalline powder

| MagSus =

}}

| Section3 = {{Chembox Structure

| CrystalStruct =

}}

| Section7 = {{Chembox Hazards

| GHSPictograms = {{GHS03}}{{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|272|302|332}}

| PPhrases = {{P-phrases|210|220|221|261|264|270|271|280|301+312|304+312|304+340|312|330|370+378|501}}

| ExternalSDS =

| MainHazards =

}}

| Section8 = {{Chembox Related

| OtherCations = calcium bromate
strontium bromate

| OtherCompounds =

}}

}}

Barium bromate is a chemical compound composed of the barium ion and the bromate ion, with the chemical formula of Ba(BrO₃)₂.