Benzethidine

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 447993914

| IUPAC_name = ethyl 1-[2-(benzyloxy)ethyl]- 4-phenylpiperidine- 4-carboxylate

| image = Benzethidine.svg

| image_class = skin-invert-image

| width = 160

| alt = Structural formula of benzethidine

| image2 = Benzethidine 3D ball.png

| alt2 = Ball-and-stick model of the benzethidine molecule

| width2 = 260

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU = S9

| legal_BR = A1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA = Schedule I

| legal_UK = Class A

| legal_US = Schedule I

| legal_DE = Anlage I

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 3691-78-9

| ATC_prefix = none

| ATC_suffix =

| PubChem = 62516

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2104234

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01518

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 56290

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = X0I74BAR02

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D12685

| C=23 | H=29

| N=1 | O=3

| smiles = O=C(OCC)C3(c1ccccc1)CCN(CCOCc2ccccc2)CC3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C23H29NO3/c1-2-27-22(25)23(21-11-7-4-8-12-21)13-15-24(16-14-23)17-18-26-19-20-9-5-3-6-10-20/h3-12H,2,13-19H2,1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = UVTBZAWTRVBTMK-UHFFFAOYSA-N

}}

Benzethidine is a 4-phenylpiperidine derivative that is related to the clinically used opioid analgesic drug pethidine (meperidine, or Demerol).{{cite book | vauthors = Maul C, Buschmann H, Sundermann B | chapter = Opioids: 3.3 Synthetic Opioids. | title = Analgesics | date = 2005 | pages = 159–169 | publisher = Wiley-VCH | isbn = 978-3-527-30403-5 }}

Benzethidine is not currently used in medicine and is a Class A/Schedule I drug which is controlled under UN drug conventions. It has similar effects to other opioid derivatives, such as analgesia, sedation, nausea and respiratory depression.{{cite journal | vauthors = Cahal DA, Dare JG, Keith D | title = A sequential trial of analgesics in labour | journal = The Journal of Obstetrics and Gynaecology of the British Commonwealth | volume = 68 | pages = 88–93 | date = February 1961 | pmid = 13689779 | doi = 10.1111/j.1471-0528.1961.tb02689.x | s2cid = 27397119 }} In the United States, the drug is a Schedule I Narcotic Controlled Substance with a DEA ACSCN of 9606 and 2014 annual aggregate manufacturing quota of nil.{{Cite web | url=http://deadiversion.usdoj.gov/quotas/conv_factor/index.html |title = Conversion Factors for Controlled Substances | work = Diversion Control Division | publisher = Drug Enforcement Agency, U.S. Department of Justice }} The most common salt in use is the hydrochloride, free base conversion ratio of 0.910.

Legal Status

=Australia=

Benzethidine is considered a Schedule 9 prohibited substance in Australia under the Poisons Standard (February 2017).{{cite web | title = Poisons Standard | date = October 2015 | url = https://www.legislation.gov.au/Details/F2017L00057 | publisher = Australian Government }} A Schedule 9 substance is a substance which may be abused or misused, the manufacture, possession, sale or use of which should be prohibited by law except when required for medical or scientific research, or for analytical, teaching or training purposes with approval of Commonwealth and/or State or Territory Health Authorities.

References

{{Reflist|2}}