Benzyltrimethylammonium hydroxide

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 461284361

| ImageFile = Triton B.png

| ImageSize = 160px

| ImageAlt = Skeletal formula of benzyltrimethylammonium hydroxide

| ImageFile1 = Benzyltrimethylammonium-hydroxide-3D-balls.png

| ImageSize1 = 150

| ImageAlt1 = Ball-and-stick model of the benzyltrimethylammonium hydroxide ions

| IUPACName = Benzyl(trimethyl)azanium hydroxide

| OtherNames = Triton B, Trimethylbenzylammonium hydroxide, N,N,N-Trimethyl-1-phenylmethanaminium hydroxide

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 100-85-6

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 8P4488425W

| SMILES = C[N+](C)(C)Cc1ccccc1.[OH-]

| PubChem = 66854

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 60218

| InChI = 1/C10H16N.H2O/c1-11(2,3)9-10-7-5-4-6-8-10;/h4-8H,9H2,1-3H3;1H2/q+1;/p-1

| InChIKey = NDKBVBUGCNGSJJ-REWHXWOFAN

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H16N.H2O/c1-11(2,3)9-10-7-5-4-6-8-10;/h4-8H,9H2,1-3H3;1H2/q+1;/p-1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NDKBVBUGCNGSJJ-UHFFFAOYSA-M

}}

|Section2={{Chembox Properties

| C=10 | H=17 | N=1 | O=1

| Appearance = Liquid, clear, slightly yellow

| Density = 0.95 g/mL

| MeltingPt =

| BoilingPt =

| Solubility = Miscible in water }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Benzyltrimethylammonium hydroxide, also known as Triton B or trimethylbenzylammonium hydroxide, is a quaternary ammonium salt that functions as an organic base. It is usually handled as a solution in water or methanol. The compound is colourless, although the solutions often appear yellowish.Mary Ellen Bos "Benzyltrimethylammonium Hydroxide" in Encyclopedia of Reagents for Organic Synthesis, 2001 John Wiley & Sons. {{doi|10.1002/047084289X.rb079}} Commercial samples often have a distinctive fish-like odour, presumably due to the presence of trimethylamine via hydrolysis.