Bolandiol dipropionate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(3S,8R,9S,10R,13S,14S,17S)-13-Methyl-17-propanoyloxy-1,2,3,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] propanoate

| image = Bolandiol dipropionate.svg

| width = 250

| tradename = Anabiol, Storinal

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 1986-53-4

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 443979

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 392020

| UNII = 595CNE7RHB

| KEGG =

| ChEBI = 31297

| ChEMBL =

| C=24 | H=36 | O=4

| SMILES = CCC(=O)O[C@H]1CC[C@@H]2[C@H]3CC[C@]4([C@H]([C@@H]3CCC2=C1)CC[C@@H]4OC(=O)CC)C

| StdInChI_Ref =

| StdInChI = 1S/C24H36O4/c1-4-22(25)27-16-7-9-17-15(14-16)6-8-19-18(17)12-13-24(3)20(19)10-11-21(24)28-23(26)5-2/h14,16-21H,4-13H2,1-3H3/t16-,17-,18+,19+,20-,21-,24-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = JFAXVZXNIGIDDA-KDWXAGHCSA-N

| synonyms = SC-7525

}}

Bolandiol dipropionate (USAN; brand names Anabiol, Storinal; former development code SC-7525; also known as bolandiol propionate (JAN), norpropandrolate, 19-nor-4-androstenediol dipropionate, or estr-4-ene-3β,17β-diol 3,17-dipropionate) is a synthetic anabolic-androgenic steroid (AAS) and derivative of 19-nortestosterone (nandrolone).{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA899|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=899–}} It is an androgen ester – specifically, the 3,17-dipropionate ester of bolandiol (19-nor-4-androstenediol).