Testosterone diacetate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(3S,8R,9S,10R,13S,14S,17S)-17-Acetyloxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate

| image = Testosterone diacetate.svg

| width = 250

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Intramuscular injection

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 4136-03-2

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 11954158

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 10128453

| UNII = 8TXA2E96LO

| KEGG = C15324

| ChEBI = 79826

| ChEMBL =

| C=23 | H=34 | O=4

| SMILES = CC(=O)O[C@H]1CC[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3CCC2=C1)CC[C@@H]4OC(=O)C)C)C

| StdInChI_Ref =

| StdInChI = 1S/C23H34O4/c1-14(24)26-17-9-11-22(3)16(13-17)5-6-18-19-7-8-21(27-15(2)25)23(19,4)12-10-20(18)22/h13,17-21H,5-12H2,1-4H3/t17-,18-,19-,20-,21-,22-,23-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = FKDRTPPOFBKQAT-FQJIPJFPSA-N

| synonyms = Testosterone 3β,17β-diacetate; 4-Androstenediol diacetate; Androst-4-ene-3β,17β-diol 3β,17β-diacetate

}}

Testosterone diacetate, or testosterone 3β,17β-diacetate, also known as 4-androstenediol diacetate, as well as androst-4-ene-3β,17β-diol 3β,17β-diacetate, is a synthetic anabolic-androgenic steroid and an androgen ester which was never marketed.{{cite book | vauthors = Parkes AS, Emmes CW | chapter = The effects of androgens and estrogens on birds | veditors = Harris RS, Thimann KV |title=Vitamins and Hormones| chapter-url = https://books.google.com/books?id=u_JhtsPyH90C&pg=PA382|date=1 January 1944|publisher=Academic Press|isbn=978-0-08-086599-7|pages=382–383}} It is the 3β,17β-diacetate diester of testosterone (androst-4-en-17β-ol-3-one), or, more accurately, of 4-androstenediol (androst-4-ene-3β,17β-diol).