Bromopride

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 459984201

| IUPAC_name = 4-amino-5-bromo-N-[2-(diethylamino)ethyl]-2-methoxybenzamide

| image = Bromopride.svg

| image2 = Bromopride-3D-balls.png

| tradename =

| Drugs.com = {{drugs.com|international|bromopride}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration = Oral, IM, IV

| bioavailability = 50 to 75% (oral)
78% (intramuscular)

| protein_bound = 40%

| metabolism = Hepatic

| elimination_half-life = 4 to 5 hours

| excretion = Renal, 10 to 14% unchanged

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 4093-35-0

| ATC_prefix = A03

| ATC_suffix = FA04

| PubChem = 2446

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = DB09018

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2352

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 75473V2YZK

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07101

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 399510

| C=14 | H=22 | Br=1 | N=3 | O=2

| smiles = Brc1cc(c(OC)cc1N)C(=O)NCCN(CC)CC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H22BrN3O2/c1-4-18(5-2)7-6-17-14(19)10-8-11(15)12(16)9-13(10)20-3/h8-9H,4-7,16H2,1-3H3,(H,17,19)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = GIYAQDDTCWHPPL-UHFFFAOYSA-N

}}

Bromopride (INN) is a dopamine antagonist with prokinetic properties widely used as an antiemetic, closely related to metoclopramide. It is not available in the United States.

Bromopride appears to be safe and effective for use in pregnancy.{{cite journal | author = Araújo JR | title = Evaluation of bromopride in nausea and vomiting of pregnancy | language = pt | journal = J Bras Ginecol | year = 1981 | volume = 91 | issue = 4 | pages = 283–5}}