Cannabidiol dimethyl ether

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 1,3-dimethoxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene

| image = CBDD_structure.png

| image_class = skin-invert-image

| width = 220px

| image2 = CBDD 3D BS.png

| image_class2 = bg-transparent

| width2 = 220px

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number = 1242-67-7

| PubChem = 3081957

| ChemSpiderID = 2339454

| ChEMBL = 499322

| ChEBI =

| UNII = MK7IHZ7MIM

| C=23 | H=34 | O=2

| smiles = CCCCCC1=CC(=C(C(=C1)OC)[C@@H]2C=C(CC[C@H]2C(=C)C)C)OC

| StdInChI = 1S/C23H34O2/c1-7-8-9-10-18-14-21(24-5)23(22(15-18)25-6)20-13-17(4)11-12-19(20)16(2)3/h13-15,19-20H,2,7-12H2,1,3-6H3/t19-,20+/m0/s1

| StdInChIKey = UYBGHBAVRNATET-VQTJNVASSA-N

}}

Cannabidiol dimethyl ether (CBDD) is a trace component of cannabis{{Citation needed|reason=Claim not mentioned in the 2 cited studies.|date=December 2023}} which can also be made synthetically. It is a potent and selective inhibitor of the enzyme 15-lipoxygenase and inhibits oxygenation of linoleic acid, a process involved in the development of atherosclerosis.{{cite journal | vauthors = Takeda S, Usami N, Yamamoto I, Watanabe K | title = Cannabidiol-2',6'-dimethyl ether, a cannabidiol derivative, is a highly potent and selective 15-lipoxygenase inhibitor | journal = Drug Metabolism and Disposition | volume = 37 | issue = 8 | pages = 1733–7 | date = August 2009 | pmid = 19406952 | doi = 10.1124/dmd.109.026930 | s2cid = 1546599 }}{{cite journal | vauthors = Takeda S, Hirayama A, Urata S, Mano N, Fukagawa K, Imamura M, Irii A, Kitajima S, Masuyama T, Nomiyama M, Tatei S, Tomita S, Kudo T, Noguchi M, Yamaguchi Y, Okamoto Y, Amamoto T, Fukunishi Y, Watanabe K, Omiecinski CJ, Aramaki H | display-authors = 6 | title = Cannabidiol-2',6'-dimethyl ether as an effective protector of 15-lipoxygenase-mediated low-density lipoprotein oxidation in vitro | journal = Biological & Pharmaceutical Bulletin | year = 2011 | volume = 34 | issue = 8 | pages = 1252–6 | pmid = 21804214 | doi = 10.1248/bpb.34.1252 | pmc = 4012644 | doi-access = free }}