Cefapirin

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 460022704

| IUPAC_name =

| image = Cefapirin.svg

| tradename =

| Drugs.com = {{drugs.com|international|cefapirin}}

| MedlinePlus = a601206

| pregnancy_AU =

| pregnancy_US = B

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US = Rx-only

| legal_status =

| routes_of_administration = Intravenous, intramuscular

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 21593-23-7

| ATC_prefix = J01

| ATC_suffix = DB08

| ATC_supplemental = {{ATCvet|G51|AA05}} {{ATCvet|J51|DB08}}

| PubChem = 30699

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01139

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 28486

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 89B59H32VN

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07636

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 554446

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1599

| C=17 | H=17 | N=3 | O=6 | S=2

| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)CSc3ccncc3)COC(=O)C)C(=O)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C17H17N3O6S2/c1-9(21)26-6-10-7-28-16-13(15(23)20(16)14(10)17(24)25)19-12(22)8-27-11-2-4-18-5-3-11/h2-5,13,16H,6-8H2,1H3,(H,19,22)(H,24,25)/t13-,16-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = UQLLWWBDSUHNEB-CZUORRHYSA-N

}}

Cefapirin (INN, also spelled cephapirin) is an injectable, first-generation cephalosporin antibiotic. It is marketed under the trade name Cefadyl. Production for use in humans has been discontinued in the United States.{{cite web | title = CEFADYL | url = http://www.accessdata.fda.gov/scripts/cder/drugsatfda/index.cfm?fuseaction=Search.Overview&DrugName=CEFADYL | archive-url = https://web.archive.org/web/20060926002502/http://www.accessdata.fda.gov/scripts/cder/drugsatfda/index.cfm?fuseaction=Search.Overview&DrugName=CEFADYL | url-status = dead | archive-date = September 26, 2006 | publisher = U.S. Food and Drug Administration }}

It also has a role in veterinary medicine as Metricure, an intrauterine preparation, and combined with prednisolone in Mastiplan, an intramammary preparation. Both are licensed in cattle.{{cn|date=March 2023}}