Cefmetazole

{{Short description|Chemical compound}}

{{Drugbox

|image2=Cefmetazole 3D.png

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 460023468

| IUPAC_name = (6R,7S)-7-(2-(cyanomethylthio)acetamido)-7-methoxy-3-((1-methyl-1H-tetrazol-5-ylthio)methyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid

| image = Cefmetazole.svg

| tradename =

| Drugs.com = {{drugs.com|international|cefmetazole}}

| MedlinePlus = a601206

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 56796-20-4

| ATC_prefix = J01

| ATC_suffix = DC09

| PubChem = 42008

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00274

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 38311

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3J962UJT8H

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D00910

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 3489

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201195

| C=15 | H=17 | N=7 | O=5 | S=3

| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@]2(OC)NC(=O)CSCC#N)CSc3nnnn3C)C(=O)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C15H17N7O5S3/c1-21-14(18-19-20-21)30-6-8-5-29-13-15(27-2,17-9(23)7-28-4-3-16)12(26)22(13)10(8)11(24)25/h13H,4-7H2,1-2H3,(H,17,23)(H,24,25)/t13-,15+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = SNBUBQHDYVFSQF-HIFRSBDPSA-N

}}

Cefmetazole is a cephamycin antibiotic, usually grouped with the second-generation cephalosporins.

__TOC__